|
Name |
1,2,4-Trimethylcyclohexane
|
Molecular Formula | C9H18 | |
IUPAC Name* |
1,2,4-trimethylcyclohexane
|
|
SMILES |
CC1CCC(C(C1)C)C
|
|
InChI |
InChI=1S/C9H18/c1-7-4-5-8(2)9(3)6-7/h7-9H,4-6H2,1-3H3
|
|
InChIKey |
VCJPCEVERINRSG-UHFFFAOYSA-N
|
|
Synonyms |
1,2,4-Trimethylcyclohexane; 2234-75-5; Cyclohexane, 1,2,4-trimethyl-; 7667-60-9; 1678-80-4; Cyclohexane, 1,2,4-trimethyl-, (1R,2R,4R)-rel-; EINECS 218-783-4; NSC 18907; AI3-18880; 1,4-Trimethylcyclohexane; Cyclohexane,2,4-trimethyl-; 1,2,4-Trimethyl cyclohexane; Cyclohexane, 1,2,4-trimethyl-, (1alpha,2beta,4beta)-; DTXSID60862883; CAA23475; NSC18907; LMFA11000635; MFCD00019385; NSC 73967; NSC-18907; AKOS015903384; (1S,2r,4s)-1,2,4-trimethylcyclohexane; DB-045874; DS-015932; (1R,2R,4R)-1,2,4-trimethyl-cyclohexane; CS-0450064; FT-0634154; FT-0773851; T0825; J-500297; 3-[2-(3-CHLORO-PHENYL)-ETHYL]-PYRIDINE-2-CARBOXYLICACIDTERT-BUTYLAMIDE
|
|
CAS | 2234-75-5 | |
PubChem CID | 91517 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 126.24 | ALogp: | 4.0 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 9 | QED Weighted: | 0.462 |
Caco-2 Permeability: | -4.386 | MDCK Permeability: | 0.00001590 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.097 |
30% Bioavailability (F30%): | 0.557 |
Blood-Brain-Barrier Penetration (BBB): | 0.875 | Plasma Protein Binding (PPB): | 93.69% |
Volume Distribution (VD): | 2.125 | Fu: | 6.49% |
CYP1A2-inhibitor: | 0.853 | CYP1A2-substrate: | 0.849 |
CYP2C19-inhibitor: | 0.178 | CYP2C19-substrate: | 0.906 |
CYP2C9-inhibitor: | 0.515 | CYP2C9-substrate: | 0.659 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.315 |
CYP3A4-inhibitor: | 0.126 | CYP3A4-substrate: | 0.307 |
Clearance (CL): | 13.967 | Half-life (T1/2): | 0.235 |
hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.078 |
Drug-inuced Liver Injury (DILI): | 0.577 | AMES Toxicity: | 0.035 |
Rat Oral Acute Toxicity: | 0.031 | Maximum Recommended Daily Dose: | 0.023 |
Skin Sensitization: | 0.791 | Carcinogencity: | 0.196 |
Eye Corrosion: | 0.985 | Eye Irritation: | 0.986 |
Respiratory Toxicity: | 0.374 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000950 | 0.432 | D04CSZ | 0.432 | ||||
ENC001888 | 0.395 | D0V8HA | 0.244 | ||||
ENC001887 | 0.394 | D0S3WH | 0.231 | ||||
ENC000411 | 0.359 | D0N6FH | 0.231 | ||||
ENC000578 | 0.356 | D0Y5ZA | 0.211 | ||||
ENC001081 | 0.326 | D07QKN | 0.191 | ||||
ENC001908 | 0.320 | D0D4JO | 0.179 | ||||
ENC003125 | 0.314 | D0H1QY | 0.178 | ||||
ENC000787 | 0.300 | D07CNL | 0.176 | ||||
ENC001254 | 0.297 | D03DVJ | 0.170 |