|
Name |
Naphthalene-1,8-diol
|
Molecular Formula | C10H8O2 | |
IUPAC Name* |
naphthalene-1,8-diol
|
|
SMILES |
C1=CC2=C(C(=C1)O)C(=CC=C2)O
|
|
InChI |
InChI=1S/C10H8O2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6,11-12H
|
|
InChIKey |
OENHRRVNRZBNNS-UHFFFAOYSA-N
|
|
Synonyms |
Naphthalene-1,8-diol; 1,8-Naphthalenediol; 569-42-6; 1,8-Dihydroxynaphthalene; JEW2VB8R33; MFCD00042701; 138999-35-6; 1,8-Naphthalenediol, radical ion(1+); EINECS 209-316-5; 1,8-Naphthalindiol; 8-hydroxy-1-naphthol; 1-Hydroxy-8-naphthol; UNII-JEW2VB8R33; SCHEMBL70219; CHEMBL203537; YSSJ3004; 1,8-Dihydroxynaphthalene, 95%; 1,8-DHN; DTXSID80205435; CHEBI:167604; BCP10859; CS-B0783; ZINC1846526; AC-950; AKOS003601449; AB90058; FS-3227; SY027091; A8134; AM20050054; FT-0607047; EN300-41347; Z415933894
|
|
CAS | 138999-35-6 | |
PubChem CID | 68438 | |
ChEMBL ID | CHEMBL203537 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 160.17 | ALogp: | 2.8 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 40.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 12 | QED Weighted: | 0.622 |
Caco-2 Permeability: | -4.629 | MDCK Permeability: | 0.00001840 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.093 | 20% Bioavailability (F20%): | 0.975 |
30% Bioavailability (F30%): | 0.989 |
Blood-Brain-Barrier Penetration (BBB): | 0.284 | Plasma Protein Binding (PPB): | 95.31% |
Volume Distribution (VD): | 0.669 | Fu: | 3.54% |
CYP1A2-inhibitor: | 0.987 | CYP1A2-substrate: | 0.631 |
CYP2C19-inhibitor: | 0.454 | CYP2C19-substrate: | 0.09 |
CYP2C9-inhibitor: | 0.518 | CYP2C9-substrate: | 0.895 |
CYP2D6-inhibitor: | 0.812 | CYP2D6-substrate: | 0.857 |
CYP3A4-inhibitor: | 0.416 | CYP3A4-substrate: | 0.194 |
Clearance (CL): | 13.317 | Half-life (T1/2): | 0.819 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.017 |
Drug-inuced Liver Injury (DILI): | 0.248 | AMES Toxicity: | 0.668 |
Rat Oral Acute Toxicity: | 0.624 | Maximum Recommended Daily Dose: | 0.039 |
Skin Sensitization: | 0.943 | Carcinogencity: | 0.84 |
Eye Corrosion: | 0.799 | Eye Irritation: | 0.994 |
Respiratory Toxicity: | 0.915 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002077 | 0.651 | D03UOT | 0.333 | ||||
ENC003034 | 0.587 | D07HBX | 0.326 | ||||
ENC000021 | 0.474 | D0O6IZ | 0.323 | ||||
ENC001512 | 0.451 | D0Y0JH | 0.318 | ||||
ENC000404 | 0.450 | D0L5PO | 0.302 | ||||
ENC000060 | 0.450 | D04JEE | 0.294 | ||||
ENC000087 | 0.448 | D0F5ZM | 0.288 | ||||
ENC004888 | 0.448 | D0H6QU | 0.282 | ||||
ENC004820 | 0.448 | D0T7OW | 0.280 | ||||
ENC003644 | 0.419 | D0H6TP | 0.279 |