|
Name |
Isobutyl benzoate
|
Molecular Formula | C11H14O2 | |
IUPAC Name* |
2-methylpropyl benzoate
|
|
SMILES |
CC(C)COC(=O)C1=CC=CC=C1
|
|
InChI |
InChI=1S/C11H14O2/c1-9(2)8-13-11(12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3
|
|
InChIKey |
KYZHGEFMXZOSJN-UHFFFAOYSA-N
|
|
Synonyms |
Isobutyl benzoate; 120-50-3; 2-Methylpropyl benzoate; Benzoic acid, isobutyl ester; BENZOIC ACID, 2-METHYLPROPYL ESTER; FEMA No. 2185; Benzoic Acid Isobutyl Ester; KQ6XZ9WJII; CHEBI:87500; 2-Methylpropyl Ester Benzoic Acid; NSC-6580; Benzoic acid-(2-methylpropyl) ester; Isobutyl benzoate (natural); UNII-KQ6XZ9WJII; NSC 6580; EINECS 204-401-3; BRN 2045961; AI3-01267; iso-butyl benzoate; Benzoic acid isobutyl; Isobutyl benzoate, 99%; Benzoic acid, isobutyl ester (6CI,7CI,8CI); DSSTox_CID_27074; DSSTox_RID_82088; Isobutyl benzoate, >=98%; DSSTox_GSID_47074; SCHEMBL298176; (2-methyl-1-propyl) benzoate; Benzoic acid-2methylpropyl ester; CHEMBL2260714; DTXSID6047074; ISOBUTYL BENZOATE [FHFI]; ISOBUTYL BENZOATE [INCI]; FEMA 2185; NSC6580; ZINC406974; BENZOIC ACID ISO-BUTYL ESTER; Tox21_302327; MFCD00048344; AKOS015889452; benzoic acid, 2,2-dimethylethyl ester; BENZOIC ACID 2-METHYLPROPYL ESTER; NCGC00256173-01; AS-61775; CAS-120-50-3; DB-041561; B0072; CS-0187444; FT-0622711; E77891; 4-(N-PROPYLAMINOCARBONYL)PHENYLBORONICACID; J-004354; Q27159676
|
|
CAS | 120-50-3 | |
PubChem CID | 61048 | |
ChEMBL ID | CHEMBL2260714 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 178.23 | ALogp: | 3.6 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 26.3 | Aromatic Rings: | 1 |
Heavy Atoms: | 13 | QED Weighted: | 0.664 |
Caco-2 Permeability: | -4.244 | MDCK Permeability: | 0.00003540 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.912 |
Blood-Brain-Barrier Penetration (BBB): | 0.189 | Plasma Protein Binding (PPB): | 94.51% |
Volume Distribution (VD): | 1.722 | Fu: | 5.28% |
CYP1A2-inhibitor: | 0.921 | CYP1A2-substrate: | 0.371 |
CYP2C19-inhibitor: | 0.792 | CYP2C19-substrate: | 0.204 |
CYP2C9-inhibitor: | 0.638 | CYP2C9-substrate: | 0.476 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.084 |
CYP3A4-inhibitor: | 0.019 | CYP3A4-substrate: | 0.211 |
Clearance (CL): | 11.226 | Half-life (T1/2): | 0.845 |
hERG Blockers: | 0.038 | Human Hepatotoxicity (H-HT): | 0.015 |
Drug-inuced Liver Injury (DILI): | 0.511 | AMES Toxicity: | 0.007 |
Rat Oral Acute Toxicity: | 0.019 | Maximum Recommended Daily Dose: | 0.008 |
Skin Sensitization: | 0.579 | Carcinogencity: | 0.119 |
Eye Corrosion: | 0.341 | Eye Irritation: | 0.99 |
Respiratory Toxicity: | 0.169 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000176 | 0.744 | D0X9RY | 0.488 | ||||
ENC000175 | 0.675 | D0B7OD | 0.481 | ||||
ENC000174 | 0.600 | D0G1VX | 0.456 | ||||
ENC000651 | 0.535 | D08MRN | 0.422 | ||||
ENC000214 | 0.532 | D02YPG | 0.403 | ||||
ENC000192 | 0.525 | D0P6UB | 0.396 | ||||
ENC001726 | 0.519 | D0T3LF | 0.391 | ||||
ENC000076 | 0.488 | D05BMG | 0.391 | ||||
ENC000013 | 0.488 | D0R1CR | 0.380 | ||||
ENC000308 | 0.457 | D05OFX | 0.365 |