|
Name |
6-Pentyl-2H-pyran-2-one
|
Molecular Formula | C10H14O2 | |
IUPAC Name* |
6-pentylpyran-2-one
|
|
SMILES |
CCCCCC1=CC=CC(=O)O1
|
|
InChI |
InChI=1S/C10H14O2/c1-2-3-4-6-9-7-5-8-10(11)12-9/h5,7-8H,2-4,6H2,1H3
|
|
InChIKey |
MAUFTTLGOUBZNA-UHFFFAOYSA-N
|
|
Synonyms |
6-Pentyl-2H-pyran-2-one; 27593-23-3; 6-Amyl-alpha-pyrone; 6-pentylpyran-2-one; 6-Pentyl-2-pyrone; 6-Amyl-2-pyrone; 2H-Pyran-2-one, 6-pentyl-; 6-PENTYL-ALPHA-PYRONE; 6-Amyl-A-pyrone; 6-Amyl-.alpha.-pyrone; FEMA No. 3696; 2-Pyrone, 6-pentyl; 6-pentyl-pyran-2-one; 5-Hydroxy-2,4-decadienoic acid delta-lactone; 6-n-pentyl-alpha-pyrone; 8JTW8HL4PJ; CHEBI:66729; NSC-721361; 5-hydroxy-2,4-decadienoic acid gamma-lactone; UNII-8JTW8HL4PJ; 6-pentyl-a-pyrone; EINECS 248-552-3; NSC721361; 6 Amyl Alpha Pyrone; 6-Amyl-alpha -pyrone; 6-Pentyl-alpha -pyrone; 2,4-Decadien-5-olide; 6-N-Amyl alpha -pyrone; 6-Pentyl-.alpha.-pyrone; alpha -Pyrone, 6-pentyl; 6-N-Amyl .alpha.-pyrone; Pyran-2-one, 6-pentyl-; .alpha.-Pyrone, 6-pentyl; DSSTox_CID_27589; DSSTox_RID_82436; DSSTox_GSID_47589; 6-n-pentyl-2h-pyran-2-one; SCHEMBL968257; CHEMBL503899; DTXSID0047589; FEMA 3696; ZINC1663619; Tox21_302570; MFCD00047551; 6-Amyl-alpha-pyrone, >=96%, FG; AKOS015839660; NSC 721361; NCGC00256764-01; AS-58448; NCI60_041518; 5-Hydroxy-2,4-decadienoic acid D-lactone; CAS-27593-23-3; DB-047250; FT-0620947; T70705; 593A233; Q27135350; 5-HYDROXY-2,4-DECADIENOIC ACID .DELTA.-LACTONE; 5-HYDROXY-2,4-DECADIENOIC ACID .DELTA.-LACTONE [FHFI]; 2,4-DECADIENOIC ACID, 5-HYDROXY-3-METHYL-, .DELTA.-LACTONE
|
|
CAS | 27593-23-3 | |
PubChem CID | 33960 | |
ChEMBL ID | CHEMBL503899 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 166.22 | ALogp: | 3.0 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 26.3 | Aromatic Rings: | 1 |
Heavy Atoms: | 12 | QED Weighted: | 0.643 |
Caco-2 Permeability: | -4.641 | MDCK Permeability: | 0.00002310 |
Pgp-inhibitor: | 0.019 | Pgp-substrate: | 0.118 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.981 |
30% Bioavailability (F30%): | 0.999 |
Blood-Brain-Barrier Penetration (BBB): | 0.263 | Plasma Protein Binding (PPB): | 92.63% |
Volume Distribution (VD): | 1.613 | Fu: | 7.67% |
CYP1A2-inhibitor: | 0.98 | CYP1A2-substrate: | 0.904 |
CYP2C19-inhibitor: | 0.804 | CYP2C19-substrate: | 0.369 |
CYP2C9-inhibitor: | 0.631 | CYP2C9-substrate: | 0.857 |
CYP2D6-inhibitor: | 0.038 | CYP2D6-substrate: | 0.477 |
CYP3A4-inhibitor: | 0.055 | CYP3A4-substrate: | 0.272 |
Clearance (CL): | 8.758 | Half-life (T1/2): | 0.704 |
hERG Blockers: | 0.182 | Human Hepatotoxicity (H-HT): | 0.081 |
Drug-inuced Liver Injury (DILI): | 0.524 | AMES Toxicity: | 0.117 |
Rat Oral Acute Toxicity: | 0.384 | Maximum Recommended Daily Dose: | 0.023 |
Skin Sensitization: | 0.332 | Carcinogencity: | 0.58 |
Eye Corrosion: | 0.955 | Eye Irritation: | 0.99 |
Respiratory Toxicity: | 0.366 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000533 | 0.575 | D0R9EQ | 0.275 | ||||
ENC000534 | 0.500 | D02HXS | 0.274 | ||||
ENC000546 | 0.463 | D01QLH | 0.273 | ||||
ENC004625 | 0.440 | D07UHS | 0.263 | ||||
ENC000861 | 0.383 | D08HQK | 0.243 | ||||
ENC001477 | 0.354 | D0P1FO | 0.241 | ||||
ENC002793 | 0.345 | D0A0FL | 0.240 | ||||
ENC004381 | 0.339 | D09QUQ | 0.240 | ||||
ENC003052 | 0.339 | D0G7DJ | 0.239 | ||||
ENC002237 | 0.333 | D06OIV | 0.239 |