|
Name |
Citronellol
|
Molecular Formula | C10H20O | |
IUPAC Name* |
3,7-dimethyloct-6-en-1-ol
|
|
SMILES |
CC(CCC=C(C)C)CCO
|
|
InChI |
InChI=1S/C10H20O/c1-9(2)5-4-6-10(3)7-8-11/h5,10-11H,4,6-8H2,1-3H3
|
|
InChIKey |
QMVPMAAFGQKVCJ-UHFFFAOYSA-N
|
|
Synonyms |
Citronellol; 106-22-9; 3,7-Dimethyloct-6-en-1-ol; beta-Citronellol; DL-Citronellol; Cephrol; 6-Octen-1-ol, 3,7-dimethyl-; 3,7-DIMETHYL-6-OCTEN-1-OL; Elenol; Rodinol; 2,3-Dihydrogeraniol; 2,6-Dimethyl-2-octen-8-ol; (+/-)-beta-Citronellol; Citronellol, dl-; .beta.-Citronellol; Dihydrogeraniol; 26489-01-0; (+/-)-3,7-dimethyloct-6-en-1-ol; CHEBI:50462; NSC 8779; 565OK72VNF; 3,7-dimethyl-oct-6-en-1-ol; NSC8779; NSC-8779; D-Citronellol;(R)-(+)-beta-Citronellol; (+/-)-Citronellol;(+/-)-beta-Citronellol; DSSTox_CID_6726; DSSTox_RID_78201; DSSTox_GSID_26726; 68916-43-8; CAS-106-22-9; (+/-)-beta-Citronellol analytical standard; Citronellol (natural); (+-)-beta-citronellol; (+-)-CITRONELLOL; (R)-(+)-.beta.-Citronellol; UNII-565OK72VNF; (+/-)-beta-Citronellol, primary pharmaceutical reference standard; CCRIS 7452; Levo-citronellol; MFCD00063214; Citronellol Natural; EINECS 203-375-0; EINECS 247-737-6; MFCD00002935; BRN 1721507; ST069325; AI3-25080; beta-Citronellol, 95%; (+-)-beta;-Citronellol; EC 203-375-0; SCHEMBL21320; (S)-(-)-|A-Citronellol; 4-01-00-02188 (Beilstein Handbook Reference); 6-Octen-1-ol,7-dimethyl-; MLS002415719; 3,7-dimethyl-oct-6-en1-ol; CHEMBL395827; DTXSID3026726; CITRONELLOL, (+/-)-; HSDB 6805; .BETA.-CITRONELLOL [MI]; WLN: Q2Y1&3UY1&1; HMS2267B17; Citronellol, >=95%, FCC, FG; Tox21_202119; Tox21_300003; (+/-)-.BETA.-CITRONELLOL; BBL009826; BDBM50037035; s5584; STK085542; AKOS005393175; CCG-266265; CS-W010917; HY-W010201; (+/-)-3,7-dimethyl-6-octen-1-ol; .BETA.-CITRONELLOL, (+/-)-; NCGC00091348-01; NCGC00091348-02; NCGC00091348-03; NCGC00091348-04; NCGC00254145-01; NCGC00259668-01; AS-14688; BP-21491; SMR000112138; SY066737; ( inverted exclamation markA)-b-Citronellol; DB-060123; DB-074976; (+/-)-beta-Citronellol, analytical standard; FT-0604381; FT-0622896; FT-0623965; FT-0623966; FT-0693159; FT-0772868; 6-Octen-1-ol, 3,7-dimethyl-, (+/-)-; EN300-1270486; W-108771; W-109198; W-110227; Q27122080
|
|
CAS | 106-22-9 | |
PubChem CID | 8842 | |
ChEMBL ID | CHEMBL395827 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 156.26 | ALogp: | 3.2 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 0 |
Heavy Atoms: | 11 | QED Weighted: | 0.603 |
Caco-2 Permeability: | -4.252 | MDCK Permeability: | 0.00001980 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.55 |
30% Bioavailability (F30%): | 0.101 |
Blood-Brain-Barrier Penetration (BBB): | 0.948 | Plasma Protein Binding (PPB): | 93.48% |
Volume Distribution (VD): | 2.272 | Fu: | 6.41% |
CYP1A2-inhibitor: | 0.65 | CYP1A2-substrate: | 0.427 |
CYP2C19-inhibitor: | 0.092 | CYP2C19-substrate: | 0.604 |
CYP2C9-inhibitor: | 0.052 | CYP2C9-substrate: | 0.765 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.115 |
CYP3A4-inhibitor: | 0.018 | CYP3A4-substrate: | 0.162 |
Clearance (CL): | 12.891 | Half-life (T1/2): | 0.593 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.573 |
Drug-inuced Liver Injury (DILI): | 0.028 | AMES Toxicity: | 0.004 |
Rat Oral Acute Toxicity: | 0.01 | Maximum Recommended Daily Dose: | 0.021 |
Skin Sensitization: | 0.857 | Carcinogencity: | 0.224 |
Eye Corrosion: | 0.915 | Eye Irritation: | 0.985 |
Respiratory Toxicity: | 0.045 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000229 | 0.600 | D0M1PQ | 0.486 | ||||
ENC000319 | 0.571 | D05XQE | 0.254 | ||||
ENC000230 | 0.568 | D0Y3KG | 0.250 | ||||
ENC003366 | 0.478 | D0C1QZ | 0.211 | ||||
ENC000396 | 0.424 | D09XWD | 0.205 | ||||
ENC000846 | 0.400 | D0ZK8H | 0.195 | ||||
ENC001150 | 0.391 | D03VFL | 0.189 | ||||
ENC000804 | 0.358 | D00WUF | 0.188 | ||||
ENC002844 | 0.346 | D03CHT | 0.184 | ||||
ENC000796 | 0.346 | D00FSV | 0.176 |