|
Name |
Linalyl acetate
|
Molecular Formula | C12H20O2 | |
IUPAC Name* |
3,7-dimethylocta-1,6-dien-3-yl acetate
|
|
SMILES |
CC(=CCCC(C)(C=C)OC(=O)C)C
|
|
InChI |
InChI=1S/C12H20O2/c1-6-12(5,14-11(4)13)9-7-8-10(2)3/h6,8H,1,7,9H2,2-5H3
|
|
InChIKey |
UWKAYLJWKGQEPM-UHFFFAOYSA-N
|
|
Synonyms |
LINALYL ACETATE; 115-95-7; Linalool acetate; 3,7-dimethylocta-1,6-dien-3-yl acetate; Bergamiol; Bergamol; Linalol acetate; Lynalyl acetate; Licareol acetate; Acetic acid linalool ester; 1,6-Octadien-3-ol, 3,7-dimethyl-, acetate; 3,7-Dimethyl-1,6-octadien-3-yl acetate; 3,7-Dimethyl-1,6-octadien-3-ol acetate; 1,6-Octadien-3-ol, 3,7-dimethyl-, 3-acetate; Ex bois de rose (synthetic); FEMA No. 2636; Phanteine; Dehydrolinalool, acetate; NSC 2138; 1,5-Dimethyl-1-vinyl-4-hexenyl acetate; 3,7-Dimethyl-1,6-ctadien-3-ol acetate; 5K47SSQ51G; CHEBI:78333; (1)-1,5-Dimethyl-1-vinylhex-4-enyl acetate; NSC-2138; 1,5-dimethyl-1-vinylhex-4-en-1-yl acetate; Acetic Acid Linalyl Ester; DSSTox_CID_6946; DSSTox_RID_78265; DSSTox_GSID_26946; (+)-1,5-Dimethyl-1-vinylhex-4-enyl acetate; Linalyl acetate (natural); Aetic Acid Linalool Ester; CAS-115-95-7; HSDB 644; LINALYL ACETATE SYNTHETIC; LINALYL ACETATER; EINECS 204-116-4; EINECS 254-806-4; MFCD00008907; UNII-5K47SSQ51G; linaloyl acetate; AI3-00941; linalyl acetate terpenes; (-)-S-Linalyl acetate; (+/-)-linalyl acetate; Acetic acid-linalyl ester; (1,5-dimethyl-1-vinyl-hex-4-enyl) acetate; EC 204-116-4; 3,6-octadien-3-ol acetate; 3,6-octadien-3-yl acetate; SCHEMBL58028; (.+/-.)-Linalyl acetate; LINALYL ACETATE [MI]; LINALOOL ACETATE, DL-; LINALYL ACETATE [FCC]; 1, 3,7-dimethyl-, acetate; LINALYL ACETATE [FHFI]; LINALYL ACETATE [HSDB]; LINALYL ACETATE [INCI]; CHEMBL502773; DTXSID7026946; WLN: 1Y&U3Y1U1OV1; FEMA 2636; LINALYL ACETATE [USP-RS]; Linalyl acetate(Linalool acetate); NSC2138; Linalyl acetate, natural, >=80%; HY-N6948; LINALYL ACETATE, (+/-)-; Linalyl acetate, analytical standard; Tox21_201306; Tox21_303134; LINALOYL ACETATE, (+/-)-; AKOS015901735; Linalyl acetate, >=97%, FCC, FG; CS-W010587; 3,7-dimethyl-1,6octadien-3-yl acetate; NCGC00164001-01; NCGC00164001-02; NCGC00257047-01; NCGC00258858-01; AC-20000; BS-49383; FT-0627862; L0049; 3,7-Dimethyl-acetate(3R)-1,6-Octadien-3-ol; E80781; (+)-3,7-Dimethyl-1,6-octadien-3-ol acetate; 1,6-Octadien-3-ol, 3, 7-dimethyl-, acetate; 3,7-Dimethyl-1,6-octadien-3-yl acetate 97%; 3,7-Dimethyl-1,6-octadien-3-yl acetate, 97%; EN300-7444436; 3,7-Dimethyl-3-acetate(3R)-1,6-Octadien-3-ol; A893739; Q188314; W-108587; Acetic acid-linalyl ester 1000 microg/mL in Acetonitrile
|
|
CAS | 115-95-7 | |
PubChem CID | 8294 | |
ChEMBL ID | CHEMBL502773 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 196.29 | ALogp: | 3.3 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 14 | QED Weighted: | 0.49 |
Caco-2 Permeability: | -4.462 | MDCK Permeability: | 0.00002560 |
Pgp-inhibitor: | 0.369 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.384 |
30% Bioavailability (F30%): | 0.028 |
Blood-Brain-Barrier Penetration (BBB): | 0.899 | Plasma Protein Binding (PPB): | 82.27% |
Volume Distribution (VD): | 1.783 | Fu: | 20.48% |
CYP1A2-inhibitor: | 0.258 | CYP1A2-substrate: | 0.161 |
CYP2C19-inhibitor: | 0.161 | CYP2C19-substrate: | 0.842 |
CYP2C9-inhibitor: | 0.038 | CYP2C9-substrate: | 0.196 |
CYP2D6-inhibitor: | 0.091 | CYP2D6-substrate: | 0.113 |
CYP3A4-inhibitor: | 0.398 | CYP3A4-substrate: | 0.314 |
Clearance (CL): | 6.363 | Half-life (T1/2): | 0.507 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.667 |
Drug-inuced Liver Injury (DILI): | 0.093 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.011 | Maximum Recommended Daily Dose: | 0.02 |
Skin Sensitization: | 0.877 | Carcinogencity: | 0.297 |
Eye Corrosion: | 0.831 | Eye Irritation: | 0.97 |
Respiratory Toxicity: | 0.073 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000145 | 0.711 | D0M1PQ | 0.319 | ||||
ENC001606 | 0.472 | D0FM2P | 0.289 | ||||
ENC000314 | 0.472 | D09XWD | 0.247 | ||||
ENC001812 | 0.450 | D0Q9HF | 0.245 | ||||
ENC001720 | 0.429 | D05XQE | 0.231 | ||||
ENC001719 | 0.429 | D0Q6DX | 0.230 | ||||
ENC001718 | 0.409 | D0ZK8H | 0.217 | ||||
ENC000319 | 0.404 | D04MWJ | 0.212 | ||||
ENC003366 | 0.389 | D05PLH | 0.203 | ||||
ENC001434 | 0.383 | D0Y4AW | 0.190 |