|
Name |
Gliotoxin
|
Molecular Formula | C13H14N2O4S2 | |
IUPAC Name* |
(1R,7S,8S,11R)-7-hydroxy-11-(hydroxymethyl)-15-methyl-12,13-dithia-9,15-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5-diene-10,14-dione
|
|
SMILES |
CN1C(=O)[C@]23CC4=CC=C[C@@H]([C@H]4N2C(=O)[C@]1(SS3)CO)O
|
|
InChI |
InChI=1S/C13H14N2O4S2/c1-14-10(18)12-5-7-3-2-4-8(17)9(7)15(12)11(19)13(14,6-16)21-20-12/h2-4,8-9,16-17H,5-6H2,1H3/t8-,9-,12+,13+/m0/s1
|
|
InChIKey |
FIVPIPIDMRVLAY-RBJBARPLSA-N
|
|
Synonyms |
gliotoxin; 67-99-2; Aspergillin; Gliotoxin from Gliocladium fimbriatum; C13H14N2O4S2; CHEBI:5385; CHEMBL331627; 5L648PH06K; NSC 102866; (3R,5aS,6S,10aR)-6-hydroxy-3-(hydroxymethyl)-2-methyl-2,3,5a,6-tetrahydro-10H-3,10a-epidithiopyrazino[1,2-a]indole-1,4-dione; (3R,5aS,6S,10aR)-6-hydroxy-3-(hydroxymethyl)-2-methyl-2,3,6,10-tetrahydro-5aH-3,10a-epidithiopyrazino[1,2-a]indole-1,4-dione; CCRIS 4025; BRN 0050675; UNII-5L648PH06K; AI3-62383; NSC102866; S.N. 12870; NSC-102866; MFCD00058534; GLIOTOXIN [MI]; SCHEMBL54420; BSPBio_001237; 10H-3,10a-Epidithiopyrazino(1,2-a)indole-1,4-dione, 2,3,5a,6-tetrahydro-6-hydroxy-3-(hydroxymethyl)-2-methyl-; 4-27-00-08902 (Beilstein Handbook Reference); DTXSID60877179; HMS1792M19; HMS1990M19; HMS3403M19; PI129; HY-N6727; ZINC3875454; BDBM50134315; CCG-35318; CCG-36058; AKOS024457211; QTL1_000040; NCGC00163466-01; NCGC00163466-02; 10H-3,10a-Epidithiopyrazino(1,2-a)indole-1,4-dione, 2,3,5a,6-hydroxy-3- (hydroxymethyl)-2-methyl-, (3R-(3-alpha,5a-beta,6-beta,10a-alpha))-; AC-31273; BG162731; CS-0029133; S. N.-12870; Q413364; SR-05000002340; SR-05000002340-2; (1R,7S,8S,11R)-7-hydroxy-11-(hydroxymethyl)-15-methyl-12,13-dithia-9,15-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5-diene-10,14-dione; (3R,5aS,6S,10aR)-2,3,5a,6-Tetrahydr o-6-hydroxy-3-(hydroxymethyl)-2-methyl-10H-3,10a-e pidithiopyrazino[1,2-a]indole-1,4-dione; (3R,5aS,6S,10aR)-2,3,5a,6-Tetrahydro-6-hydroxy-3-(hydroxymethyl)-2-methyl-10H-3,10a-epidithiopyrazino[1,2-a]indole-1,4-dione; 10H-3,10A-EPIDITHIOPYRAZINO(1,2-A)INDOLE-1,4-DIONE, 2,3,5A,6-TETRAHYDRO-6-HYDROXY-3-(HYDROXYMETHYL)-2-METHYL-, (3R,5AS,6S,10AR)-; 2,3,5a,6-Tetrahydro-6-hydroxy-3-(hydroxymethyl)-2-methyl-10H-3,10a-epidithiopyrazino[1,2-a]indole-1,4 dione; 6-Hydroxy-3-(hydroxymethyl)-2-methyl-2,3,6,10-tetrahydro-5aH-3,10a-epidithiopyrazino[1,2-a]indole-1,4-dione; 7-hydroxy-11-hydroxymethyl-12-methyl-14,15-dithia-9,12-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5-diene-10,13-dione
|
|
CAS | 67-99-2 | |
PubChem CID | 6223 | |
ChEMBL ID | CHEMBL331627 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 326.4 | ALogp: | -0.7 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 132.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 21 | QED Weighted: | 0.667 |
Caco-2 Permeability: | -5.027 | MDCK Permeability: | 0.00002250 |
Pgp-inhibitor: | 0.013 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.164 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.071 |
Blood-Brain-Barrier Penetration (BBB): | 0.15 | Plasma Protein Binding (PPB): | 57.80% |
Volume Distribution (VD): | 0.623 | Fu: | 54.61% |
CYP1A2-inhibitor: | 0.014 | CYP1A2-substrate: | 0.101 |
CYP2C19-inhibitor: | 0.489 | CYP2C19-substrate: | 0.887 |
CYP2C9-inhibitor: | 0.827 | CYP2C9-substrate: | 0.102 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.09 |
CYP3A4-inhibitor: | 0.089 | CYP3A4-substrate: | 0.97 |
Clearance (CL): | 8.767 | Half-life (T1/2): | 0.703 |
hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.16 |
Drug-inuced Liver Injury (DILI): | 0.98 | AMES Toxicity: | 0.04 |
Rat Oral Acute Toxicity: | 0.783 | Maximum Recommended Daily Dose: | 0.882 |
Skin Sensitization: | 0.804 | Carcinogencity: | 0.908 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.605 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000993 | 0.538 | D0Z8EX | 0.214 | ||||
ENC004752 | 0.506 | D0CL9S | 0.209 | ||||
ENC006009 | 0.438 | D08EOD | 0.207 | ||||
ENC005509 | 0.438 | D0R2KF | 0.198 | ||||
ENC003617 | 0.357 | D0TS1Z | 0.195 | ||||
ENC003438 | 0.347 | D09PZO | 0.195 | ||||
ENC005392 | 0.318 | D0IL7L | 0.194 | ||||
ENC003809 | 0.295 | D0I5DS | 0.191 | ||||
ENC003992 | 0.277 | D0W7RJ | 0.191 | ||||
ENC003595 | 0.277 | D0G6AB | 0.188 |