|
Name |
(R,2E,4E)-6-((2S,5R)-5-ethyltetrahydrofuran-2-yl)-6-hydroxy-4-methylhexa-2,4-dienoic acid
|
Molecular Formula | C13H20O4 | |
IUPAC Name* |
6-(5-ethyloxolan-2-yl)-6-hydroxy-4-methylhexa-2,4-dienoicacid
|
|
SMILES |
CCC1CCC(C(O)C=C(C)C=CC(=O)O)O1
|
|
InChI |
InChI=1S/C13H20O4/c1-3-10-5-6-12(17-10)11(14)8-9(2)4-7-13(15)16/h4,7-8,10-12,14H,3,5-6H2,1-2H3,(H,15,16)/b7-4+,9-8+/t10-,11-,12+/m1/s1
|
|
InChIKey |
YFXWKMSVPOOXOT-KLQIFJBCSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 240.3 | ALogp: | 1.9 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 17 | QED Weighted: | 0.572 |
Caco-2 Permeability: | -4.973 | MDCK Permeability: | 0.00002130 |
Pgp-inhibitor: | 0.028 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.016 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.014 |
Blood-Brain-Barrier Penetration (BBB): | 0.157 | Plasma Protein Binding (PPB): | 79.13% |
Volume Distribution (VD): | 0.264 | Fu: | 12.85% |
CYP1A2-inhibitor: | 0.019 | CYP1A2-substrate: | 0.194 |
CYP2C19-inhibitor: | 0.034 | CYP2C19-substrate: | 0.586 |
CYP2C9-inhibitor: | 0.008 | CYP2C9-substrate: | 0.94 |
CYP2D6-inhibitor: | 0.016 | CYP2D6-substrate: | 0.348 |
CYP3A4-inhibitor: | 0.008 | CYP3A4-substrate: | 0.119 |
Clearance (CL): | 5.843 | Half-life (T1/2): | 0.9 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.199 |
Drug-inuced Liver Injury (DILI): | 0.026 | AMES Toxicity: | 0.506 |
Rat Oral Acute Toxicity: | 0.014 | Maximum Recommended Daily Dose: | 0.8 |
Skin Sensitization: | 0.689 | Carcinogencity: | 0.798 |
Eye Corrosion: | 0.579 | Eye Irritation: | 0.379 |
Respiratory Toxicity: | 0.396 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006058 | 1.000 | D0N3NO | 0.212 | ||||
ENC005743 | 0.410 | D02DGU | 0.207 | ||||
ENC005742 | 0.407 | D0G3PI | 0.207 | ||||
ENC004075 | 0.348 | D00DKK | 0.207 | ||||
ENC001164 | 0.333 | D0FG6M | 0.202 | ||||
ENC003005 | 0.277 | D0V0IX | 0.196 | ||||
ENC001095 | 0.269 | D09MPU | 0.188 | ||||
ENC003384 | 0.268 | D05HXX | 0.188 | ||||
ENC003852 | 0.263 | D0S8LV | 0.187 | ||||
ENC005835 | 0.258 | D0I0EG | 0.186 |