![]() |
Name |
(3R)-mellein methyl ether
|
Molecular Formula | C11H12O3 | |
IUPAC Name* |
8-methoxy-3-methyl-3,4-dihydroisochromen-1-one
|
|
SMILES |
COc1cccc2c1C(=O)OC(C)C2
|
|
InChI |
InChI=1S/C11H12O3/c1-7-6-8-4-3-5-9(13-2)10(8)11(12)14-7/h3-5,7H,6H2,1-2H3/t7-/m1/s1
|
|
InChIKey |
AYIDXPPINFIJKW-SSDOTTSWSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 192.21 | ALogp: | 1.8 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 35.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 14 | QED Weighted: | 0.641 |
Caco-2 Permeability: | -4.488 | MDCK Permeability: | 0.00002730 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.047 |
Blood-Brain-Barrier Penetration (BBB): | 0.486 | Plasma Protein Binding (PPB): | 79.47% |
Volume Distribution (VD): | 0.716 | Fu: | 9.84% |
CYP1A2-inhibitor: | 0.944 | CYP1A2-substrate: | 0.84 |
CYP2C19-inhibitor: | 0.646 | CYP2C19-substrate: | 0.702 |
CYP2C9-inhibitor: | 0.161 | CYP2C9-substrate: | 0.864 |
CYP2D6-inhibitor: | 0.278 | CYP2D6-substrate: | 0.873 |
CYP3A4-inhibitor: | 0.334 | CYP3A4-substrate: | 0.252 |
Clearance (CL): | 11.038 | Half-life (T1/2): | 0.562 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.235 |
Drug-inuced Liver Injury (DILI): | 0.699 | AMES Toxicity: | 0.178 |
Rat Oral Acute Toxicity: | 0.026 | Maximum Recommended Daily Dose: | 0.074 |
Skin Sensitization: | 0.543 | Carcinogencity: | 0.838 |
Eye Corrosion: | 0.062 | Eye Irritation: | 0.915 |
Respiratory Toxicity: | 0.12 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001451 | ![]() |
1.000 | D07MGA | ![]() |
0.299 | ||
ENC005578 | ![]() |
1.000 | D0L1WV | ![]() |
0.294 | ||
ENC004821 | ![]() |
1.000 | D0X5KF | ![]() |
0.291 | ||
ENC000856 | ![]() |
0.667 | D08CCE | ![]() |
0.286 | ||
ENC000584 | ![]() |
0.667 | D03SKD | ![]() |
0.284 | ||
ENC002082 | ![]() |
0.667 | D0L1JW | ![]() |
0.280 | ||
ENC002342 | ![]() |
0.660 | D0E9CD | ![]() |
0.278 | ||
ENC001305 | ![]() |
0.600 | D03DIG | ![]() |
0.275 | ||
ENC002387 | ![]() |
0.600 | D09SSC | ![]() |
0.272 | ||
ENC000757 | ![]() |
0.509 | D0R9VR | ![]() |
0.269 |