|
Name |
Cochlioquinone G
|
Molecular Formula | C28H39NO6 | |
IUPAC Name* |
7-butan-2-yl-2-hydroxy-17-(2-hydroxypropan-2-yl)-6,12,14-trimethyl-11,18-dioxa-8-azapentacyclo[10.8.0.03,10.05,9.014,19]icosa-3(10),5(9),6-triene-4,19-dione
|
|
SMILES |
CCC(C)c1[nH]c2c(c1C)C(=O)C1=C(C2=O)C(O)C2C(C)(CCC3OC(C(C)(C)O)CCC32C)O1
|
|
InChI |
InChI=1S/C28H39NO6/c1-8-13(2)19-14(3)17-20(29-19)21(30)18-23(32)25-27(6)11-9-15(26(4,5)33)34-16(27)10-12-28(25,7)35-24(18)22(17)31/h13,15-16,23,25,29,32-33H,8-12H2,1-7H3/t13-,15+,16+,23+,25+,27-,28+/m0/s1
|
|
InChIKey |
WIQZPBCPUPLZRU-LPSNGGIKSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 485.62 | ALogp: | 4.4 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 108.9 | Aromatic Rings: | 5 |
Heavy Atoms: | 35 | QED Weighted: | 0.563 |
Caco-2 Permeability: | -4.819 | MDCK Permeability: | 0.00001430 |
Pgp-inhibitor: | 0.891 | Pgp-substrate: | 0.021 |
Human Intestinal Absorption (HIA): | 0.318 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.007 |
Blood-Brain-Barrier Penetration (BBB): | 0.062 | Plasma Protein Binding (PPB): | 100.17% |
Volume Distribution (VD): | 1.507 | Fu: | 1.38% |
CYP1A2-inhibitor: | 0.111 | CYP1A2-substrate: | 0.955 |
CYP2C19-inhibitor: | 0.08 | CYP2C19-substrate: | 0.554 |
CYP2C9-inhibitor: | 0.255 | CYP2C9-substrate: | 0.221 |
CYP2D6-inhibitor: | 0.07 | CYP2D6-substrate: | 0.166 |
CYP3A4-inhibitor: | 0.166 | CYP3A4-substrate: | 0.694 |
Clearance (CL): | 3.056 | Half-life (T1/2): | 0.087 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.231 |
Drug-inuced Liver Injury (DILI): | 0.563 | AMES Toxicity: | 0.049 |
Rat Oral Acute Toxicity: | 0.934 | Maximum Recommended Daily Dose: | 0.867 |
Skin Sensitization: | 0.314 | Carcinogencity: | 0.106 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.196 |
Respiratory Toxicity: | 0.971 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002674 | 0.626 | D0W2EK | 0.245 | ||||
ENC000943 | 0.585 | D0W5LS | 0.222 | ||||
ENC001862 | 0.548 | D0Y7LD | 0.221 | ||||
ENC005794 | 0.519 | D04VIS | 0.218 | ||||
ENC003638 | 0.492 | D08IWD | 0.217 | ||||
ENC004571 | 0.474 | D0T2PL | 0.214 | ||||
ENC003006 | 0.472 | D05BTM | 0.214 | ||||
ENC003011 | 0.457 | D05CHI | 0.210 | ||||
ENC004251 | 0.444 | D02IQY | 0.210 | ||||
ENC004570 | 0.439 | D0C7JF | 0.209 |