![]() |
Name |
(3S)-3-[(R)-8-hydroxynonyl]-6-hydroxy-8-methoxy-3,4-dihydroisochroman-1-one
|
Molecular Formula | C19H28O5 | |
IUPAC Name* |
6-hydroxy-3-(8-hydroxynonyl)-8-methoxy-3,4-dihydroisochromen-1-one
|
|
SMILES |
COc1cc(O)cc2c1C(=O)OC(CCCCCCCC(C)O)C2
|
|
InChI |
InChI=1S/C19H28O5/c1-13(20)8-6-4-3-5-7-9-16-11-14-10-15(21)12-17(23-2)18(14)19(22)24-16/h10,12-13,16,20-21H,3-9,11H2,1-2H3/t13-,16+/m1/s1
|
|
InChIKey |
JHEKXAOMMGTWSG-CJNGLKHVSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 336.43 | ALogp: | 3.6 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 76.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 24 | QED Weighted: | 0.519 |
Caco-2 Permeability: | -4.706 | MDCK Permeability: | 0.00004120 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.022 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.62 |
30% Bioavailability (F30%): | 0.152 |
Blood-Brain-Barrier Penetration (BBB): | 0.701 | Plasma Protein Binding (PPB): | 92.68% |
Volume Distribution (VD): | 0.762 | Fu: | 3.30% |
CYP1A2-inhibitor: | 0.794 | CYP1A2-substrate: | 0.819 |
CYP2C19-inhibitor: | 0.747 | CYP2C19-substrate: | 0.295 |
CYP2C9-inhibitor: | 0.317 | CYP2C9-substrate: | 0.966 |
CYP2D6-inhibitor: | 0.873 | CYP2D6-substrate: | 0.82 |
CYP3A4-inhibitor: | 0.681 | CYP3A4-substrate: | 0.141 |
Clearance (CL): | 11.426 | Half-life (T1/2): | 0.713 |
hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.095 |
Drug-inuced Liver Injury (DILI): | 0.265 | AMES Toxicity: | 0.026 |
Rat Oral Acute Toxicity: | 0.01 | Maximum Recommended Daily Dose: | 0.886 |
Skin Sensitization: | 0.55 | Carcinogencity: | 0.044 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.336 |
Respiratory Toxicity: | 0.275 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005187 | ![]() |
0.506 | D07MGA | ![]() |
0.280 | ||
ENC002387 | ![]() |
0.500 | D0I4DQ | ![]() |
0.271 | ||
ENC002573 | ![]() |
0.481 | D0MM8N | ![]() |
0.267 | ||
ENC005476 | ![]() |
0.449 | D0G2KD | ![]() |
0.265 | ||
ENC002946 | ![]() |
0.449 | D01WUA | ![]() |
0.248 | ||
ENC003741 | ![]() |
0.444 | D09ANG | ![]() |
0.248 | ||
ENC004669 | ![]() |
0.444 | D0L7AS | ![]() |
0.248 | ||
ENC002062 | ![]() |
0.430 | D03LGG | ![]() |
0.243 | ||
ENC004979 | ![]() |
0.427 | D0U5CE | ![]() |
0.243 | ||
ENC004082 | ![]() |
0.423 | D09PJX | ![]() |
0.236 |