![]() |
Name |
3-O-methyl-5-(8-methoxyl-6-oxononyl)-resorcinol
|
Molecular Formula | C17H26O4 | |
IUPAC Name* |
9-(3-hydroxy-5-methoxyphenyl)-2-methoxynonan-4-one
|
|
SMILES |
COc1cc(O)cc(CCCCCC(=O)CC(C)OC)c1
|
|
InChI |
InChI=1S/C17H26O4/c1-13(20-2)9-15(18)8-6-4-5-7-14-10-16(19)12-17(11-14)21-3/h10-13,19H,4-9H2,1-3H3
|
|
InChIKey |
NXOSFSLMZISQRK-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 294.39 | ALogp: | 3.5 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 55.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 21 | QED Weighted: | 0.656 |
Caco-2 Permeability: | -4.663 | MDCK Permeability: | 0.00002120 |
Pgp-inhibitor: | 0.297 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.992 |
30% Bioavailability (F30%): | 0.698 |
Blood-Brain-Barrier Penetration (BBB): | 0.239 | Plasma Protein Binding (PPB): | 75.21% |
Volume Distribution (VD): | 1.788 | Fu: | 9.94% |
CYP1A2-inhibitor: | 0.525 | CYP1A2-substrate: | 0.852 |
CYP2C19-inhibitor: | 0.44 | CYP2C19-substrate: | 0.786 |
CYP2C9-inhibitor: | 0.218 | CYP2C9-substrate: | 0.898 |
CYP2D6-inhibitor: | 0.632 | CYP2D6-substrate: | 0.891 |
CYP3A4-inhibitor: | 0.531 | CYP3A4-substrate: | 0.335 |
Clearance (CL): | 11.691 | Half-life (T1/2): | 0.867 |
hERG Blockers: | 0.037 | Human Hepatotoxicity (H-HT): | 0.397 |
Drug-inuced Liver Injury (DILI): | 0.099 | AMES Toxicity: | 0.016 |
Rat Oral Acute Toxicity: | 0.021 | Maximum Recommended Daily Dose: | 0.266 |
Skin Sensitization: | 0.411 | Carcinogencity: | 0.025 |
Eye Corrosion: | 0.05 | Eye Irritation: | 0.72 |
Respiratory Toxicity: | 0.04 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005792 | ![]() |
0.632 | D0U5CE | ![]() |
0.337 | ||
ENC005790 | ![]() |
0.556 | D03LGG | ![]() |
0.337 | ||
ENC004665 | ![]() |
0.386 | D05CKR | ![]() |
0.277 | ||
ENC000349 | ![]() |
0.375 | D03XTC | ![]() |
0.275 | ||
ENC002685 | ![]() |
0.364 | D02XJY | ![]() |
0.274 | ||
ENC004666 | ![]() |
0.360 | D0VU8Q | ![]() |
0.272 | ||
ENC004667 | ![]() |
0.356 | D0G6VL | ![]() |
0.272 | ||
ENC004671 | ![]() |
0.353 | D0P1RL | ![]() |
0.265 | ||
ENC004668 | ![]() |
0.348 | D0G2KD | ![]() |
0.263 | ||
ENC003972 | ![]() |
0.344 | D0O1UZ | ![]() |
0.260 |