![]() |
Name |
pyrenosetin E
|
Molecular Formula | C25H35NO5 | |
IUPAC Name* |
3-(3-hydroxybut-1-enyl)-5'-(hydroxymethyl)-1',4,7,9b-tetramethylspiro[3,3a,5a,6,7,8,9,9a-octahydrocyclopenta[a]naphthalene-2,3'-pyrrolidine]-1,2',4'-trione
|
|
SMILES |
CC1=CC2CC(C)CCC2C2(C)C(=O)C3(C(=O)C(CO)N(C)C3=O)C(C=CC(C)O)C12
|
|
InChI |
InChI=1S/C25H35NO5/c1-13-6-8-17-16(10-13)11-14(2)20-18(9-7-15(3)28)25(22(30)24(17,20)4)21(29)19(12-27)26(5)23(25)31/h7,9,11,13,15-20,27-28H,6,8,10,12H2,1-5H3/b9-7+/t13-,15-,16+,17-,18+,19-,20+,24+,25+/m0/s1
|
|
InChIKey |
JBZGVPJZPTUTAU-OBGJEZBRSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 429.56 | ALogp: | 2.1 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 94.9 | Aromatic Rings: | 4 |
Heavy Atoms: | 31 | QED Weighted: | 0.531 |
Caco-2 Permeability: | -4.883 | MDCK Permeability: | 0.00009290 |
Pgp-inhibitor: | 0.125 | Pgp-substrate: | 0.859 |
Human Intestinal Absorption (HIA): | 0.327 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.025 |
Blood-Brain-Barrier Penetration (BBB): | 0.872 | Plasma Protein Binding (PPB): | 78.22% |
Volume Distribution (VD): | 0.97 | Fu: | 23.04% |
CYP1A2-inhibitor: | 0.004 | CYP1A2-substrate: | 0.867 |
CYP2C19-inhibitor: | 0.078 | CYP2C19-substrate: | 0.93 |
CYP2C9-inhibitor: | 0.019 | CYP2C9-substrate: | 0.521 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.107 |
CYP3A4-inhibitor: | 0.826 | CYP3A4-substrate: | 0.935 |
Clearance (CL): | 11.9 | Half-life (T1/2): | 0.098 |
hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.078 |
Drug-inuced Liver Injury (DILI): | 0.893 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.714 | Maximum Recommended Daily Dose: | 0.101 |
Skin Sensitization: | 0.031 | Carcinogencity: | 0.308 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.803 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D0E9KA | ![]() |
0.260 | ||||
![]() |
D0I5DS | ![]() |
0.248 | ||||
![]() |
D0W2EK | ![]() |
0.238 | ||||
![]() |
D04SFH | ![]() |
0.238 | ||||
![]() |
D0IL7L | ![]() |
0.222 | ||||
![]() |
D0IX6I | ![]() |
0.222 | ||||
![]() |
D06AEO | ![]() |
0.222 | ||||
![]() |
D0I1LH | ![]() |
0.220 | ||||
![]() |
D0CZ1Q | ![]() |
0.219 | ||||
![]() |
D0D2TN | ![]() |
0.219 |