![]() |
Name |
Phomoparagin A
|
Molecular Formula | C29H37NO3 | |
IUPAC Name* |
4-benzyl-2-hydroxy-5,6,14,16-tetramethyl-7-methylidene-11-oxa-3-azapentacyclo[8.8.0.01,5.08,18.012,19]octadec-16-en-2-one
|
|
SMILES |
C=C1C2OC3CC(C)CC(C)=CC4C3C2C2(C(=O)NC(Cc3ccccc3)C2(C)C1C)C4O
|
|
InChI |
InChI=1S/C29H37NO3/c1-15-11-16(2)13-21-23-20(12-15)26(31)29-24(23)25(33-21)17(3)18(4)28(29,5)22(30-27(29)32)14-19-9-7-6-8-10-19/h6-10,12,16,18,20-26,31H,3,11,13-14H2,1-2,4-5H3,(H,30,32)/b15-12-/t16-,18-,20+,21-,22+,23-,24+,25-,26-,28+,29+/m1/s1
|
|
InChIKey |
IGWABSJTWXINBH-FWILZWOQSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 447.62 | ALogp: | 4.3 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 58.6 | Aromatic Rings: | 6 |
Heavy Atoms: | 33 | QED Weighted: | 0.638 |
Caco-2 Permeability: | -4.837 | MDCK Permeability: | 0.00016661 |
Pgp-inhibitor: | 0.089 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.011 |
30% Bioavailability (F30%): | 0.005 |
Blood-Brain-Barrier Penetration (BBB): | 0.246 | Plasma Protein Binding (PPB): | 92.16% |
Volume Distribution (VD): | 1.553 | Fu: | 3.91% |
CYP1A2-inhibitor: | 0.022 | CYP1A2-substrate: | 0.307 |
CYP2C19-inhibitor: | 0.453 | CYP2C19-substrate: | 0.827 |
CYP2C9-inhibitor: | 0.231 | CYP2C9-substrate: | 0.159 |
CYP2D6-inhibitor: | 0.017 | CYP2D6-substrate: | 0.339 |
CYP3A4-inhibitor: | 0.711 | CYP3A4-substrate: | 0.721 |
Clearance (CL): | 11.496 | Half-life (T1/2): | 0.007 |
hERG Blockers: | 0.053 | Human Hepatotoxicity (H-HT): | 0.396 |
Drug-inuced Liver Injury (DILI): | 0.038 | AMES Toxicity: | 0.043 |
Rat Oral Acute Toxicity: | 0.993 | Maximum Recommended Daily Dose: | 0.885 |
Skin Sensitization: | 0.138 | Carcinogencity: | 0.05 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.955 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003937 | ![]() |
0.564 | D0V3ZA | ![]() |
0.250 | ||
ENC003956 | ![]() |
0.529 | D0SP3D | ![]() |
0.243 | ||
ENC003936 | ![]() |
0.521 | D09NNH | ![]() |
0.243 | ||
ENC005759 | ![]() |
0.516 | D01TSI | ![]() |
0.243 | ||
ENC006060 | ![]() |
0.484 | D05VQI | ![]() |
0.235 | ||
ENC005760 | ![]() |
0.472 | D06CWH | ![]() |
0.232 | ||
ENC005127 | ![]() |
0.468 | D0W7RJ | ![]() |
0.231 | ||
ENC005128 | ![]() |
0.460 | D0R1BD | ![]() |
0.230 | ||
ENC004540 | ![]() |
0.437 | D0M6VK | ![]() |
0.227 | ||
ENC004543 | ![]() |
0.415 | D0IN7I | ![]() |
0.226 |