|
Name |
Purpurogenolide F
|
Molecular Formula | C24H26O9 | |
IUPAC Name* |
21-hydroxy-7,7,15,20,22-pentamethylspiro[2,6,17,19-tetraoxaheptacyclo[11.7.1.11,3.03,12.04,9.015,21.018,22]docosa-4,8-diene-11,2'-oxirane]-10,16-dione
|
|
SMILES |
CC1OC2OC(=O)C3(C)CC4C5(CO5)C5=CC(=O)OC(C)(C)C5=CC5OC16OC6(C54C)C23O
|
|
InChI |
InChI=1S/C24H26O9/c1-10-23-24(33-23)20(5)13(8-19(4)16(26)30-17(29-10)22(19,24)27)21(9-28-21)12-7-15(25)32-18(2,3)11(12)6-14(20)31-23/h6-7,10,13-14,17,27H,8-9H2,1-5H3/t10-,13-,14+,17-,19+,20-,21+,22+,23+,24-/m1/s1
|
|
InChIKey |
DVVDMESWPKTXJA-WZBLSJEASA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 458.46 | ALogp: | 0.9 |
HBD: | 1 | HBA: | 9 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 116.4 | Aromatic Rings: | 8 |
Heavy Atoms: | 33 | QED Weighted: | 0.424 |
Caco-2 Permeability: | -5.249 | MDCK Permeability: | 0.00001440 |
Pgp-inhibitor: | 0.993 | Pgp-substrate: | 0.05 |
Human Intestinal Absorption (HIA): | 0.09 | 20% Bioavailability (F20%): | 0.954 |
30% Bioavailability (F30%): | 0.909 |
Blood-Brain-Barrier Penetration (BBB): | 0.917 | Plasma Protein Binding (PPB): | 78.18% |
Volume Distribution (VD): | 1.813 | Fu: | 19.46% |
CYP1A2-inhibitor: | 0.002 | CYP1A2-substrate: | 0.988 |
CYP2C19-inhibitor: | 0.022 | CYP2C19-substrate: | 0.83 |
CYP2C9-inhibitor: | 0.044 | CYP2C9-substrate: | 0.006 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.091 |
CYP3A4-inhibitor: | 0.161 | CYP3A4-substrate: | 0.934 |
Clearance (CL): | 2.208 | Half-life (T1/2): | 0.044 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.211 |
Drug-inuced Liver Injury (DILI): | 0.958 | AMES Toxicity: | 0.972 |
Rat Oral Acute Toxicity: | 0.939 | Maximum Recommended Daily Dose: | 0.17 |
Skin Sensitization: | 0.046 | Carcinogencity: | 0.957 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.045 |
Respiratory Toxicity: | 0.904 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003843 | 0.624 | D06IIB | 0.234 | ||||
ENC002931 | 0.455 | D0KR9U | 0.234 | ||||
ENC003927 | 0.442 | D02QJH | 0.231 | ||||
ENC005628 | 0.380 | D02JNM | 0.229 | ||||
ENC002849 | 0.309 | D03ZZK | 0.227 | ||||
ENC004709 | 0.304 | D0Y2YP | 0.217 | ||||
ENC002987 | 0.301 | D0G6AB | 0.216 | ||||
ENC005315 | 0.297 | D0P0HT | 0.209 | ||||
ENC002851 | 0.296 | D0Q4SD | 0.208 | ||||
ENC003408 | 0.294 | D0D2TN | 0.207 |