|
Name |
21-O-deacetyl-19, 20-epoxycytochalasin Q
|
Molecular Formula | C28H35NO6 | |
IUPAC Name* |
18-benzyl-2,6-dihydroxy-6,8,15,16-tetramethyl-4,14-dioxa-19-azapentacyclo[10.8.0.01,17.03,5.013,15]icos-10-ene-7,20-dione
|
|
SMILES |
CC1CC=CC2C3OC3(C)C(C)C3C(Cc4ccccc4)NC(=O)C23C(O)C2OC2C(C)(O)C1=O
|
|
InChI |
InChI=1S/C28H35NO6/c1-14-9-8-12-17-23-27(4,35-23)15(2)19-18(13-16-10-6-5-7-11-16)29-25(32)28(17,19)22(31)20-24(34-20)26(3,33)21(14)30/h5-8,10-12,14-15,17-20,22-24,31,33H,9,13H2,1-4H3,(H,29,32)/b12-8+/t14-,15-,17-,18-,19-,20-,22+,23-,24+,26-,27+,28-/m0/s1
|
|
InChIKey |
CROHHODFFQILKQ-GHDXXCIASA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 481.59 | ALogp: | 1.8 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 111.7 | Aromatic Rings: | 6 |
Heavy Atoms: | 35 | QED Weighted: | 0.442 |
Caco-2 Permeability: | -5.022 | MDCK Permeability: | 0.00015436 |
Pgp-inhibitor: | 0.158 | Pgp-substrate: | 0.169 |
Human Intestinal Absorption (HIA): | 0.039 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.019 |
Blood-Brain-Barrier Penetration (BBB): | 0.726 | Plasma Protein Binding (PPB): | 90.92% |
Volume Distribution (VD): | 2.033 | Fu: | 8.87% |
CYP1A2-inhibitor: | 0.007 | CYP1A2-substrate: | 0.249 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.604 |
CYP2C9-inhibitor: | 0.016 | CYP2C9-substrate: | 0.062 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.196 |
CYP3A4-inhibitor: | 0.699 | CYP3A4-substrate: | 0.575 |
Clearance (CL): | 16.034 | Half-life (T1/2): | 0.047 |
hERG Blockers: | 0.056 | Human Hepatotoxicity (H-HT): | 0.288 |
Drug-inuced Liver Injury (DILI): | 0.536 | AMES Toxicity: | 0.029 |
Rat Oral Acute Toxicity: | 0.928 | Maximum Recommended Daily Dose: | 0.636 |
Skin Sensitization: | 0.032 | Carcinogencity: | 0.187 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.913 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001886 | 0.820 | D0W7RJ | 0.250 | ||||
ENC004310 | 0.720 | D06CWH | 0.248 | ||||
ENC002202 | 0.672 | D0SP3D | 0.243 | ||||
ENC005505 | 0.661 | D0V3ZA | 0.243 | ||||
ENC005175 | 0.661 | D0D4YZ | 0.242 | ||||
ENC003763 | 0.661 | D0R1BD | 0.240 | ||||
ENC005506 | 0.661 | D09NNH | 0.236 | ||||
ENC003712 | 0.653 | D01TSI | 0.236 | ||||
ENC001756 | 0.628 | D00OAY | 0.232 | ||||
ENC002828 | 0.615 | D07HOF | 0.231 |