|
Name |
cyclo(l-Tyr-l-Pro)
|
Molecular Formula | C14H16N2O3 | |
IUPAC Name* |
3-[(4-hydroxyphenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
|
|
SMILES |
O=C1NC(Cc2ccc(O)cc2)C(=O)N2CCCC12
|
|
InChI |
InChI=1S/C14H16N2O3/c17-10-5-3-9(4-6-10)8-11-14(19)16-7-1-2-12(16)13(18)15-11/h3-6,11-12,17H,1-2,7-8H2,(H,15,18)/t11-,12-/m0/s1
|
|
InChIKey |
LSGOTAXPWMCUCK-RYUDHWBXSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 260.29 | ALogp: | 0.4 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 69.6 | Aromatic Rings: | 3 |
Heavy Atoms: | 19 | QED Weighted: | 0.827 |
Caco-2 Permeability: | -4.885 | MDCK Permeability: | 0.00000573 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.026 | 20% Bioavailability (F20%): | 0.794 |
30% Bioavailability (F30%): | 0.599 |
Blood-Brain-Barrier Penetration (BBB): | 0.229 | Plasma Protein Binding (PPB): | 34.03% |
Volume Distribution (VD): | 0.549 | Fu: | 60.51% |
CYP1A2-inhibitor: | 0.021 | CYP1A2-substrate: | 0.111 |
CYP2C19-inhibitor: | 0.217 | CYP2C19-substrate: | 0.107 |
CYP2C9-inhibitor: | 0.158 | CYP2C9-substrate: | 0.876 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.554 |
CYP3A4-inhibitor: | 0.11 | CYP3A4-substrate: | 0.153 |
Clearance (CL): | 10.215 | Half-life (T1/2): | 0.82 |
hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.637 |
Drug-inuced Liver Injury (DILI): | 0.14 | AMES Toxicity: | 0.017 |
Rat Oral Acute Toxicity: | 0.614 | Maximum Recommended Daily Dose: | 0.383 |
Skin Sensitization: | 0.32 | Carcinogencity: | 0.315 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.016 |
Respiratory Toxicity: | 0.04 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
D0S2BV | 0.477 | ||||||
D01CRB | 0.309 | ||||||
D0W1RY | 0.308 | ||||||
D0B3QM | 0.300 | ||||||
D0I0DL | 0.295 | ||||||
D0Q5NX | 0.289 | ||||||
D06ZPS | 0.271 | ||||||
D0X9ZC | 0.271 | ||||||
D02DMQ | 0.269 | ||||||
D03UOT | 0.267 |