![]() |
Name |
N-(2-benzenepropanoic acid) stachybotrylactam
|
Molecular Formula | C32H39NO6 | |
IUPAC Name* |
2-(3,4'-dihydroxy-4,4,7,8a-tetramethyl-6'-oxospiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-3,8-dihydrofuro[2,3-e]isoindole]-7'-yl)-3-phenylpropanoicacid
|
|
SMILES |
CC1CCC2C(C)(C)C(O)CCC2(C)C12Cc1c(O)cc3c(c1O2)CN(C(Cc1ccccc1)C(=O)O)C3=O
|
|
InChI |
InChI=1S/C32H39NO6/c1-18-10-11-25-30(2,3)26(35)12-13-31(25,4)32(18)16-21-24(34)15-20-22(27(21)39-32)17-33(28(20)36)23(29(37)38)14-19-8-6-5-7-9-19/h5-9,15,18,23,25-26,34-35H,10-14,16-17H2,1-4H3,(H,37,38)/t18-,23?,25-,26+,31-,32+/m0/s1
|
|
InChIKey |
MUPAWUGNYWIXIO-MLVXMIQLSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 533.67 | ALogp: | 5.0 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 107.3 | Aromatic Rings: | 6 |
Heavy Atoms: | 39 | QED Weighted: | 0.492 |
Caco-2 Permeability: | -5.6 | MDCK Permeability: | 0.00001840 |
Pgp-inhibitor: | 0.01 | Pgp-substrate: | 0.056 |
Human Intestinal Absorption (HIA): | 0.047 | 20% Bioavailability (F20%): | 0.333 |
30% Bioavailability (F30%): | 0.845 |
Blood-Brain-Barrier Penetration (BBB): | 0.02 | Plasma Protein Binding (PPB): | 99.28% |
Volume Distribution (VD): | 0.585 | Fu: | 0.87% |
CYP1A2-inhibitor: | 0.06 | CYP1A2-substrate: | 0.225 |
CYP2C19-inhibitor: | 0.033 | CYP2C19-substrate: | 0.564 |
CYP2C9-inhibitor: | 0.327 | CYP2C9-substrate: | 0.938 |
CYP2D6-inhibitor: | 0.044 | CYP2D6-substrate: | 0.255 |
CYP3A4-inhibitor: | 0.053 | CYP3A4-substrate: | 0.385 |
Clearance (CL): | 17.615 | Half-life (T1/2): | 0.136 |
hERG Blockers: | 0.068 | Human Hepatotoxicity (H-HT): | 0.552 |
Drug-inuced Liver Injury (DILI): | 0.822 | AMES Toxicity: | 0.003 |
Rat Oral Acute Toxicity: | 0.908 | Maximum Recommended Daily Dose: | 0.907 |
Skin Sensitization: | 0.431 | Carcinogencity: | 0.02 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.705 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002034 | ![]() |
0.636 | D0D7KC | ![]() |
0.300 | ||
ENC002992 | ![]() |
0.636 | D06PSS | ![]() |
0.293 | ||
ENC003019 | ![]() |
0.632 | D0P2YU | ![]() |
0.289 | ||
ENC003020 | ![]() |
0.581 | D06CWH | ![]() |
0.286 | ||
ENC002673 | ![]() |
0.581 | D0TB8C | ![]() |
0.275 | ||
ENC005396 | ![]() |
0.581 | D0NS6H | ![]() |
0.268 | ||
ENC003552 | ![]() |
0.558 | D01TSI | ![]() |
0.262 | ||
ENC003008 | ![]() |
0.556 | D0V3ZA | ![]() |
0.262 | ||
ENC002996 | ![]() |
0.529 | D09NNH | ![]() |
0.262 | ||
ENC003789 | ![]() |
0.529 | D0SP3D | ![]() |
0.262 |