![]() |
Name |
2α-acetoxystachybotrylactam acetate
|
Molecular Formula | C27H35NO7 | |
IUPAC Name* |
(3-acetyloxy-4'-hydroxy-4,4,7,8a-tetramethyl-6'-oxospiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-7,8-dihydro-3H-furo[2,3-e]isoindole]-2-yl)acetate
|
|
SMILES |
CC(=O)OC1CC2(C)C(CCC(C)C23Cc2c(O)cc4c(c2O3)CNC4=O)C(C)(C)C1OC(C)=O
|
|
InChI |
InChI=1S/C27H35NO7/c1-13-7-8-21-25(4,5)23(34-15(3)30)20(33-14(2)29)11-26(21,6)27(13)10-17-19(31)9-16-18(22(17)35-27)12-28-24(16)32/h9,13,20-21,23,31H,7-8,10-12H2,1-6H3,(H,28,32)/t13-,20-,21-,23+,26-,27+/m0/s1
|
|
InChIKey |
QBNJJIMKFSSAPW-YHGXLSETSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 485.58 | ALogp: | 3.7 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 111.2 | Aromatic Rings: | 5 |
Heavy Atoms: | 35 | QED Weighted: | 0.599 |
Caco-2 Permeability: | -4.837 | MDCK Permeability: | 0.00001200 |
Pgp-inhibitor: | 0.139 | Pgp-substrate: | 0.944 |
Human Intestinal Absorption (HIA): | 0.356 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.079 |
Blood-Brain-Barrier Penetration (BBB): | 0.357 | Plasma Protein Binding (PPB): | 94.60% |
Volume Distribution (VD): | 0.555 | Fu: | 15.22% |
CYP1A2-inhibitor: | 0.042 | CYP1A2-substrate: | 0.096 |
CYP2C19-inhibitor: | 0.029 | CYP2C19-substrate: | 0.336 |
CYP2C9-inhibitor: | 0.192 | CYP2C9-substrate: | 0.907 |
CYP2D6-inhibitor: | 0.834 | CYP2D6-substrate: | 0.342 |
CYP3A4-inhibitor: | 0.375 | CYP3A4-substrate: | 0.448 |
Clearance (CL): | 5.258 | Half-life (T1/2): | 0.311 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.664 |
Drug-inuced Liver Injury (DILI): | 0.609 | AMES Toxicity: | 0.013 |
Rat Oral Acute Toxicity: | 0.882 | Maximum Recommended Daily Dose: | 0.856 |
Skin Sensitization: | 0.134 | Carcinogencity: | 0.028 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.049 |
Respiratory Toxicity: | 0.199 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003259 | ![]() |
0.802 | D0H2MO | ![]() |
0.275 | ||
ENC001975 | ![]() |
0.657 | D0G7KJ | ![]() |
0.262 | ||
ENC003017 | ![]() |
0.657 | D08BDT | ![]() |
0.262 | ||
ENC003009 | ![]() |
0.657 | D0V2JK | ![]() |
0.261 | ||
ENC002673 | ![]() |
0.623 | D0X4RS | ![]() |
0.261 | ||
ENC005396 | ![]() |
0.623 | D0X7XG | ![]() |
0.260 | ||
ENC003020 | ![]() |
0.623 | D09WYX | ![]() |
0.253 | ||
ENC002994 | ![]() |
0.593 | D0AA0L | ![]() |
0.250 | ||
ENC003014 | ![]() |
0.549 | D02CNR | ![]() |
0.246 | ||
ENC002009 | ![]() |
0.540 | D0Z8HG | ![]() |
0.246 |