![]() |
Name |
Neocyclocitrinol E
|
Molecular Formula | C25H36O5 | |
IUPAC Name* |
6-(2,3-dihydroxyhex-4-en-2-yl)-13,15-dihydroxy-5-methyltetracyclo[11.4.1.02,10.05,9]octadeca-1(17),10-dien-12-one
|
|
SMILES |
CC=CC(O)C(C)(O)C1CCC2C3=CC(=O)C4(O)CC(=CCC(O)C4)C3CCC21C
|
|
InChI |
InChI=1S/C25H36O5/c1-4-5-21(27)24(3,29)20-9-8-19-18-12-22(28)25(30)13-15(6-7-16(26)14-25)17(18)10-11-23(19,20)2/h4-6,12,16-17,19-21,26-27,29-30H,7-11,13-14H2,1-3H3/b5-4+/t16-,17+,19-,20-,21+,23-,24+,25+/m0/s1
|
|
InChIKey |
JBYRBIHFPZDYFX-XQECXLKPSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 416.56 | ALogp: | 2.8 |
HBD: | 4 | HBA: | 5 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 98.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 30 | QED Weighted: | 0.527 |
Caco-2 Permeability: | -4.933 | MDCK Permeability: | 0.00001670 |
Pgp-inhibitor: | 0.02 | Pgp-substrate: | 0.696 |
Human Intestinal Absorption (HIA): | 0.476 | 20% Bioavailability (F20%): | 0.721 |
30% Bioavailability (F30%): | 0.018 |
Blood-Brain-Barrier Penetration (BBB): | 0.958 | Plasma Protein Binding (PPB): | 89.66% |
Volume Distribution (VD): | 1.528 | Fu: | 7.09% |
CYP1A2-inhibitor: | 0.004 | CYP1A2-substrate: | 0.675 |
CYP2C19-inhibitor: | 0.023 | CYP2C19-substrate: | 0.8 |
CYP2C9-inhibitor: | 0.017 | CYP2C9-substrate: | 0.324 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.083 |
CYP3A4-inhibitor: | 0.573 | CYP3A4-substrate: | 0.874 |
Clearance (CL): | 5.786 | Half-life (T1/2): | 0.19 |
hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.031 |
Drug-inuced Liver Injury (DILI): | 0.128 | AMES Toxicity: | 0.474 |
Rat Oral Acute Toxicity: | 0.879 | Maximum Recommended Daily Dose: | 0.873 |
Skin Sensitization: | 0.017 | Carcinogencity: | 0.872 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.98 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005349 | ![]() |
0.562 | D02ZGI | ![]() |
0.291 | ||
ENC005350 | ![]() |
0.514 | D05BTM | ![]() |
0.281 | ||
ENC004864 | ![]() |
0.323 | D0N1TP | ![]() |
0.281 | ||
ENC003053 | ![]() |
0.323 | D0T2PL | ![]() |
0.281 | ||
ENC006035 | ![]() |
0.323 | D02VPX | ![]() |
0.276 | ||
ENC005610 | ![]() |
0.323 | D06XMU | ![]() |
0.270 | ||
ENC004804 | ![]() |
0.317 | D0K0EK | ![]() |
0.270 | ||
ENC005438 | ![]() |
0.317 | D0B4RU | ![]() |
0.270 | ||
ENC004757 | ![]() |
0.317 | D01QUS | ![]() |
0.269 | ||
ENC001984 | ![]() |
0.317 | D0Q6NZ | ![]() |
0.265 |