![]() |
Name |
Aspergillussanone G
|
Molecular Formula | C35H46O9 | |
IUPAC Name* |
2,4,6,9-tetrahydroxy-2-[10-hydroxy-10-[5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-3,7-dimethyldeca-2,6-dienyl]-5,7-dimethylphenalene-1,3-dione
|
|
SMILES |
CC(=CCC1(O)C(=O)c2c(O)cc(C)c3c(O)c(C)c(O)c(c23)C1=O)CCC=C(C)CCC(O)C1(C)CCC(C(C)(C)O)O1
|
|
InChI |
InChI=1S/C35H46O9/c1-18(11-12-23(37)34(7)15-14-24(44-34)33(5,6)42)9-8-10-19(2)13-16-35(43)31(40)26-22(36)17-20(3)25-27(26)28(32(35)41)30(39)21(4)29(25)38/h9,13,17,23-24,36-39,42-43H,8,10-12,14-16H2,1-7H3/b18-9+,19-13+/t23?,24-,34+,35-/m0/s1
|
|
InChIKey |
AAVSZQDNLAZAOL-XDMGBAKNSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 610.74 | ALogp: | 5.6 |
HBD: | 6 | HBA: | 9 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 164.7 | Aromatic Rings: | 4 |
Heavy Atoms: | 44 | QED Weighted: | 0.145 |
Caco-2 Permeability: | -4.916 | MDCK Permeability: | 0.00001020 |
Pgp-inhibitor: | 0.701 | Pgp-substrate: | 0.718 |
Human Intestinal Absorption (HIA): | 0.933 | 20% Bioavailability (F20%): | 0.966 |
30% Bioavailability (F30%): | 0.072 |
Blood-Brain-Barrier Penetration (BBB): | 0.037 | Plasma Protein Binding (PPB): | 96.68% |
Volume Distribution (VD): | 1.241 | Fu: | 3.48% |
CYP1A2-inhibitor: | 0.063 | CYP1A2-substrate: | 0.265 |
CYP2C19-inhibitor: | 0.042 | CYP2C19-substrate: | 0.34 |
CYP2C9-inhibitor: | 0.23 | CYP2C9-substrate: | 0.502 |
CYP2D6-inhibitor: | 0.279 | CYP2D6-substrate: | 0.131 |
CYP3A4-inhibitor: | 0.261 | CYP3A4-substrate: | 0.343 |
Clearance (CL): | 3.308 | Half-life (T1/2): | 0.041 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.393 |
Drug-inuced Liver Injury (DILI): | 0.474 | AMES Toxicity: | 0.513 |
Rat Oral Acute Toxicity: | 0.027 | Maximum Recommended Daily Dose: | 0.531 |
Skin Sensitization: | 0.469 | Carcinogencity: | 0.358 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.206 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005338 | ![]() |
0.827 | D0WY9N | ![]() |
0.273 | ||
ENC005337 | ![]() |
0.769 | D03VFL | ![]() |
0.266 | ||
ENC005340 | ![]() |
0.715 | D0G4OD | ![]() |
0.247 | ||
ENC003495 | ![]() |
0.699 | D0FX2Q | ![]() |
0.244 | ||
ENC003114 | ![]() |
0.671 | D04VEJ | ![]() |
0.234 | ||
ENC003842 | ![]() |
0.662 | D02GAC | ![]() |
0.222 | ||
ENC003496 | ![]() |
0.662 | D0G3DL | ![]() |
0.221 | ||
ENC005341 | ![]() |
0.611 | D05CHI | ![]() |
0.221 | ||
ENC003494 | ![]() |
0.597 | D0Q0PR | ![]() |
0.216 | ||
ENC004068 | ![]() |
0.351 | D0R6RC | ![]() |
0.216 |