|
Name |
(S)-phenopyrrozin
|
Molecular Formula | C11H18O4 | |
IUPAC Name* |
2-hexylidene-3-methylbutanedioicacid
|
|
SMILES |
CCCCCC=C(C(=O)O)C(C)C(=O)O
|
|
InChI |
InChI=1S/C11H18O4/c1-3-4-5-6-7-9(11(14)15)8(2)10(12)13/h7-8H,3-6H2,1-2H3,(H,12,13)(H,14,15)/b9-7+/t8-/m1/s1
|
|
InChIKey |
YTUQECDNJQCQAE-KGOFQHAKSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 214.26 | ALogp: | 2.3 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 74.6 | Aromatic Rings: | 0 |
Heavy Atoms: | 15 | QED Weighted: | 0.504 |
Caco-2 Permeability: | -5.634 | MDCK Permeability: | 0.00307406 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.031 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.012 |
Blood-Brain-Barrier Penetration (BBB): | 0.649 | Plasma Protein Binding (PPB): | 88.07% |
Volume Distribution (VD): | 0.295 | Fu: | 8.16% |
CYP1A2-inhibitor: | 0.012 | CYP1A2-substrate: | 0.094 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.058 |
CYP2C9-inhibitor: | 0.003 | CYP2C9-substrate: | 0.906 |
CYP2D6-inhibitor: | 0.013 | CYP2D6-substrate: | 0.093 |
CYP3A4-inhibitor: | 0.009 | CYP3A4-substrate: | 0.006 |
Clearance (CL): | 3.364 | Half-life (T1/2): | 0.858 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.156 |
Drug-inuced Liver Injury (DILI): | 0.063 | AMES Toxicity: | 0.001 |
Rat Oral Acute Toxicity: | 0.266 | Maximum Recommended Daily Dose: | 0.004 |
Skin Sensitization: | 0.334 | Carcinogencity: | 0.02 |
Eye Corrosion: | 0.98 | Eye Irritation: | 0.989 |
Respiratory Toxicity: | 0.107 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
D02GIU | 0.360 | ||||||
D0Y3KG | 0.300 | ||||||
D00ENY | 0.280 | ||||||
D0E4WR | 0.276 | ||||||
D0AY9Q | 0.266 | ||||||
D0X5SI | 0.264 | ||||||
D0Z0MG | 0.263 | ||||||
D0N3NO | 0.256 | ||||||
D06VNK | 0.255 | ||||||
D0UE9X | 0.247 |