![]() |
Name |
cercolagenlic A
|
Molecular Formula | C14H14O6 | |
IUPAC Name* |
3-hydroxy-4-(7-hydroxy-5-methyl-4-oxochromen-2-yl)butanoicacid
|
|
SMILES |
Cc1cc(O)cc2oc(CC(O)CC(=O)O)cc(=O)c12
|
|
InChI |
InChI=1S/C14H14O6/c1-7-2-8(15)4-12-14(7)11(17)6-10(20-12)3-9(16)5-13(18)19/h2,4,6,9,15-16H,3,5H2,1H3,(H,18,19)/t9-/m0/s1
|
|
InChIKey |
DZMPHIDGENHYNY-VIFPVBQESA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 278.26 | ALogp: | 1.2 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 108.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 20 | QED Weighted: | 0.784 |
Caco-2 Permeability: | -5.21 | MDCK Permeability: | 0.00006720 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.994 |
Human Intestinal Absorption (HIA): | 0.23 | 20% Bioavailability (F20%): | 0.962 |
30% Bioavailability (F30%): | 0.998 |
Blood-Brain-Barrier Penetration (BBB): | 0.059 | Plasma Protein Binding (PPB): | 76.29% |
Volume Distribution (VD): | 0.422 | Fu: | 30.21% |
CYP1A2-inhibitor: | 0.085 | CYP1A2-substrate: | 0.295 |
CYP2C19-inhibitor: | 0.03 | CYP2C19-substrate: | 0.062 |
CYP2C9-inhibitor: | 0.024 | CYP2C9-substrate: | 0.945 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.189 |
CYP3A4-inhibitor: | 0.016 | CYP3A4-substrate: | 0.104 |
Clearance (CL): | 8.671 | Half-life (T1/2): | 0.9 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.166 |
Drug-inuced Liver Injury (DILI): | 0.578 | AMES Toxicity: | 0.06 |
Rat Oral Acute Toxicity: | 0.065 | Maximum Recommended Daily Dose: | 0.767 |
Skin Sensitization: | 0.178 | Carcinogencity: | 0.053 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.285 |
Respiratory Toxicity: | 0.227 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D04AIT | ![]() |
0.333 | ||||
![]() |
D0K8KX | ![]() |
0.295 | ||||
![]() |
D06NSS | ![]() |
0.274 | ||||
![]() |
D0G7IY | ![]() |
0.263 | ||||
![]() |
D0O6KE | ![]() |
0.263 | ||||
![]() |
D06FVX | ![]() |
0.257 | ||||
![]() |
D06GCK | ![]() |
0.255 | ||||
![]() |
D02UFG | ![]() |
0.253 | ||||
![]() |
D0G5UB | ![]() |
0.253 | ||||
![]() |
D04XEG | ![]() |
0.250 |