![]() |
Name |
spiro[5H,10H-dipyrrolo[1,2-a:1′,2′-d]pyrazine-2(3H),2′-[2H]-indole]-3′,5,10(1′H)trione
|
Molecular Formula | C24H28N2O6 | |
IUPAC Name* |
5',5'a-dihydroxy-6-methoxy-8'-(3-methylbut-2-enyl)spiro[1H-indole-2,7'-2,3,8,8a,9a-hexahydro-1H-cyclopenta[f]indolizine]-3,4',9'-trione
|
|
SMILES |
COc1ccc2c(c1)NC1(C2=O)C(CC=C(C)C)C2C(=O)C3CCCN3C(=O)C2(O)C1O
|
|
InChI |
InChI=1S/C24H28N2O6/c1-12(2)6-9-15-18-19(27)17-5-4-10-26(17)22(30)24(18,31)21(29)23(15)20(28)14-8-7-13(32-3)11-16(14)25-23/h6-8,11,15,17-18,21,25,29,31H,4-5,9-10H2,1-3H3/t15-,17+,18?,21+,23-,24-/m1/s1
|
|
InChIKey |
CSODVVRAMVNUGS-AEENMYMZSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 440.5 | ALogp: | 1.3 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 116.2 | Aromatic Rings: | 5 |
Heavy Atoms: | 32 | QED Weighted: | 0.614 |
Caco-2 Permeability: | -5.109 | MDCK Permeability: | 0.00001910 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.517 |
Human Intestinal Absorption (HIA): | 0.176 | 20% Bioavailability (F20%): | 0.024 |
30% Bioavailability (F30%): | 0.009 |
Blood-Brain-Barrier Penetration (BBB): | 0.61 | Plasma Protein Binding (PPB): | 91.51% |
Volume Distribution (VD): | 1.575 | Fu: | 7.03% |
CYP1A2-inhibitor: | 0.018 | CYP1A2-substrate: | 0.517 |
CYP2C19-inhibitor: | 0.131 | CYP2C19-substrate: | 0.713 |
CYP2C9-inhibitor: | 0.076 | CYP2C9-substrate: | 0.75 |
CYP2D6-inhibitor: | 0.013 | CYP2D6-substrate: | 0.248 |
CYP3A4-inhibitor: | 0.252 | CYP3A4-substrate: | 0.39 |
Clearance (CL): | 4.838 | Half-life (T1/2): | 0.046 |
hERG Blockers: | 0.033 | Human Hepatotoxicity (H-HT): | 0.932 |
Drug-inuced Liver Injury (DILI): | 0.938 | AMES Toxicity: | 0.015 |
Rat Oral Acute Toxicity: | 0.833 | Maximum Recommended Daily Dose: | 0.884 |
Skin Sensitization: | 0.149 | Carcinogencity: | 0.054 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
Respiratory Toxicity: | 0.283 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005479 | ![]() |
0.663 | D06YFA | ![]() |
0.262 | ||
ENC001958 | ![]() |
0.462 | D06HBQ | ![]() |
0.257 | ||
ENC003264 | ![]() |
0.462 | D01TSI | ![]() |
0.249 | ||
ENC002020 | ![]() |
0.444 | D0W6DG | ![]() |
0.248 | ||
ENC003281 | ![]() |
0.438 | D02IQY | ![]() |
0.247 | ||
ENC000837 | ![]() |
0.438 | D01XWG | ![]() |
0.240 | ||
ENC002520 | ![]() |
0.432 | D09OBB | ![]() |
0.237 | ||
ENC003265 | ![]() |
0.426 | D0Q5NX | ![]() |
0.237 | ||
ENC001941 | ![]() |
0.415 | D05GKD | ![]() |
0.237 | ||
ENC002260 | ![]() |
0.407 | D0SP3D | ![]() |
0.235 |