![]() |
Name |
5S,6S-phomalactone
|
Molecular Formula | C8H10O3 | |
IUPAC Name* |
3-hydroxy-2-prop-1-enyl-2,3-dihydropyran-6-one
|
|
SMILES |
CC=CC1OC(=O)C=CC1O
|
|
InChI |
InChI=1S/C8H10O3/c1-2-3-7-6(9)4-5-8(10)11-7/h2-7,9H,1H3/b3-2+/t6-,7-/m0/s1
|
|
InChIKey |
OKDRUMBNXIYUEO-VHJVCUAWSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 154.16 | ALogp: | 0.4 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 11 | QED Weighted: | 0.449 |
Caco-2 Permeability: | -4.606 | MDCK Permeability: | 0.00002340 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.965 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.509 |
30% Bioavailability (F30%): | 0.985 |
Blood-Brain-Barrier Penetration (BBB): | 0.12 | Plasma Protein Binding (PPB): | 87.59% |
Volume Distribution (VD): | 0.453 | Fu: | 25.05% |
CYP1A2-inhibitor: | 0.887 | CYP1A2-substrate: | 0.923 |
CYP2C19-inhibitor: | 0.396 | CYP2C19-substrate: | 0.126 |
CYP2C9-inhibitor: | 0.103 | CYP2C9-substrate: | 0.912 |
CYP2D6-inhibitor: | 0.366 | CYP2D6-substrate: | 0.816 |
CYP3A4-inhibitor: | 0.054 | CYP3A4-substrate: | 0.203 |
Clearance (CL): | 13.507 | Half-life (T1/2): | 0.859 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.404 |
Drug-inuced Liver Injury (DILI): | 0.878 | AMES Toxicity: | 0.159 |
Rat Oral Acute Toxicity: | 0.27 | Maximum Recommended Daily Dose: | 0.017 |
Skin Sensitization: | 0.418 | Carcinogencity: | 0.684 |
Eye Corrosion: | 0.859 | Eye Irritation: | 0.967 |
Respiratory Toxicity: | 0.38 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D0L1WV | ![]() |
0.197 | ||||
![]() |
D0Z8EX | ![]() |
0.175 | ||||
![]() |
D0K7LU | ![]() |
0.162 | ||||
![]() |
D03KXY | ![]() |
0.154 | ||||
![]() |
D0WE3O | ![]() |
0.154 | ||||
![]() |
D0X7JN | ![]() |
0.153 | ||||
![]() |
D0CL9S | ![]() |
0.152 | ||||
![]() |
D0Y7DP | ![]() |
0.152 | ||||
![]() |
D07XSN | ![]() |
0.152 | ||||
![]() |
D03TGJ | ![]() |
0.151 |