![]() |
Name |
Septoreremophilane I
|
Molecular Formula | C15H24O2 | |
IUPAC Name* |
3-(3-hydroxyprop-1-en-2-yl)-4a,5-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol
|
|
SMILES |
C=C(CO)C1CC2(C)C(=CC1O)CCCC2C
|
|
InChI |
InChI=1S/C15H24O2/c1-10(9-16)13-8-15(3)11(2)5-4-6-12(15)7-14(13)17/h7,11,13-14,16-17H,1,4-6,8-9H2,2-3H3/t11-,13-,14-,15+/m1/s1
|
|
InChIKey |
UXCJUICTNVRSRT-NGFQHRJXSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 236.35 | ALogp: | 2.7 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 40.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 17 | QED Weighted: | 0.721 |
Caco-2 Permeability: | -4.431 | MDCK Permeability: | 0.00001230 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.702 |
30% Bioavailability (F30%): | 0.537 |
Blood-Brain-Barrier Penetration (BBB): | 0.997 | Plasma Protein Binding (PPB): | 58.49% |
Volume Distribution (VD): | 1.049 | Fu: | 53.75% |
CYP1A2-inhibitor: | 0.051 | CYP1A2-substrate: | 0.518 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.805 |
CYP2C9-inhibitor: | 0.013 | CYP2C9-substrate: | 0.149 |
CYP2D6-inhibitor: | 0.017 | CYP2D6-substrate: | 0.712 |
CYP3A4-inhibitor: | 0.068 | CYP3A4-substrate: | 0.352 |
Clearance (CL): | 8.284 | Half-life (T1/2): | 0.357 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.155 |
Drug-inuced Liver Injury (DILI): | 0.078 | AMES Toxicity: | 0.284 |
Rat Oral Acute Toxicity: | 0.436 | Maximum Recommended Daily Dose: | 0.259 |
Skin Sensitization: | 0.077 | Carcinogencity: | 0.894 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.078 |
Respiratory Toxicity: | 0.945 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001829 | ![]() |
0.475 | D0IT2G | ![]() |
0.274 | ||
ENC001437 | ![]() |
0.475 | D07DVK | ![]() |
0.274 | ||
ENC001078 | ![]() |
0.460 | D0CW1P | ![]() |
0.274 | ||
ENC005063 | ![]() |
0.446 | D0KR5B | ![]() |
0.272 | ||
ENC005065 | ![]() |
0.394 | D0CZ1Q | ![]() |
0.266 | ||
ENC001832 | ![]() |
0.381 | D0D1SG | ![]() |
0.258 | ||
ENC001924 | ![]() |
0.381 | D0I1LH | ![]() |
0.255 | ||
ENC004555 | ![]() |
0.362 | D0I5DS | ![]() |
0.253 | ||
ENC005060 | ![]() |
0.352 | D0R7JT | ![]() |
0.253 | ||
ENC000965 | ![]() |
0.348 | D03HYX | ![]() |
0.247 |