![]() |
Name |
7-(γ,γ-dimethylallyloxy)-5-methoxy-4-methylcoumarin
|
Molecular Formula | C16H18O4 | |
IUPAC Name* |
4-methoxy-5-methyl-7-(3-methylbut-2-enoxy)chromen-2-one
|
|
SMILES |
COc1cc(=O)oc2cc(OCC=C(C)C)cc(C)c12
|
|
InChI |
InChI=1S/C16H18O4/c1-10(2)5-6-19-12-7-11(3)16-13(18-4)9-15(17)20-14(16)8-12/h5,7-9H,6H2,1-4H3
|
|
InChIKey |
GDICQVNBLOTPQY-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 274.32 | ALogp: | 3.5 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 48.7 | Aromatic Rings: | 2 |
Heavy Atoms: | 20 | QED Weighted: | 0.619 |
Caco-2 Permeability: | -4.767 | MDCK Permeability: | 0.00002000 |
Pgp-inhibitor: | 0.024 | Pgp-substrate: | 0.014 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.265 |
30% Bioavailability (F30%): | 0.989 |
Blood-Brain-Barrier Penetration (BBB): | 0.059 | Plasma Protein Binding (PPB): | 77.96% |
Volume Distribution (VD): | 1.311 | Fu: | 11.04% |
CYP1A2-inhibitor: | 0.939 | CYP1A2-substrate: | 0.939 |
CYP2C19-inhibitor: | 0.865 | CYP2C19-substrate: | 0.516 |
CYP2C9-inhibitor: | 0.659 | CYP2C9-substrate: | 0.896 |
CYP2D6-inhibitor: | 0.403 | CYP2D6-substrate: | 0.893 |
CYP3A4-inhibitor: | 0.433 | CYP3A4-substrate: | 0.262 |
Clearance (CL): | 13.75 | Half-life (T1/2): | 0.348 |
hERG Blockers: | 0.031 | Human Hepatotoxicity (H-HT): | 0.947 |
Drug-inuced Liver Injury (DILI): | 0.613 | AMES Toxicity: | 0.102 |
Rat Oral Acute Toxicity: | 0.021 | Maximum Recommended Daily Dose: | 0.101 |
Skin Sensitization: | 0.43 | Carcinogencity: | 0.518 |
Eye Corrosion: | 0.021 | Eye Irritation: | 0.947 |
Respiratory Toxicity: | 0.323 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000982 | ![]() |
0.678 | D06GCK | ![]() |
0.292 | ||
ENC002958 | ![]() |
0.455 | D0FA2O | ![]() |
0.291 | ||
ENC006013 | ![]() |
0.449 | D0G4KG | ![]() |
0.271 | ||
ENC003879 | ![]() |
0.432 | D06BLQ | ![]() |
0.267 | ||
ENC004833 | ![]() |
0.411 | D0S5CH | ![]() |
0.266 | ||
ENC001442 | ![]() |
0.402 | D0B1IP | ![]() |
0.250 | ||
ENC005277 | ![]() |
0.398 | D0A8FB | ![]() |
0.243 | ||
ENC002205 | ![]() |
0.395 | D05QDC | ![]() |
0.240 | ||
ENC003430 | ![]() |
0.395 | D07TWN | ![]() |
0.237 | ||
ENC004845 | ![]() |
0.395 | D0O6KE | ![]() |
0.235 |