![]() |
Name |
Talaketides B
|
Molecular Formula | C9H12O5 | |
IUPAC Name* |
4-acetyl-4,5-dihydroxy-3-methoxy-5-methylcyclopent-2-en-1-one
|
|
SMILES |
COC1=CC(=O)C(C)(O)C1(O)C(C)=O
|
|
InChI |
InChI=1S/C9H12O5/c1-5(10)9(13)7(14-3)4-6(11)8(9,2)12/h4,12-13H,1-3H3/t8-,9-/m1/s1
|
|
InChIKey |
BLVIHWFDGFECBZ-RKDXNWHRSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 200.19 | ALogp: | -0.8 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 83.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 14 | QED Weighted: | 0.636 |
Caco-2 Permeability: | -4.968 | MDCK Permeability: | 0.00005490 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.043 |
Human Intestinal Absorption (HIA): | 0.048 | 20% Bioavailability (F20%): | 0.05 |
30% Bioavailability (F30%): | 0.038 |
Blood-Brain-Barrier Penetration (BBB): | 0.911 | Plasma Protein Binding (PPB): | 25.33% |
Volume Distribution (VD): | 0.583 | Fu: | 71.36% |
CYP1A2-inhibitor: | 0.014 | CYP1A2-substrate: | 0.948 |
CYP2C19-inhibitor: | 0.019 | CYP2C19-substrate: | 0.863 |
CYP2C9-inhibitor: | 0.006 | CYP2C9-substrate: | 0.054 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.089 |
CYP3A4-inhibitor: | 0.005 | CYP3A4-substrate: | 0.898 |
Clearance (CL): | 1.706 | Half-life (T1/2): | 0.657 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.734 |
Drug-inuced Liver Injury (DILI): | 0.622 | AMES Toxicity: | 0.126 |
Rat Oral Acute Toxicity: | 0.061 | Maximum Recommended Daily Dose: | 0.026 |
Skin Sensitization: | 0.21 | Carcinogencity: | 0.199 |
Eye Corrosion: | 0.017 | Eye Irritation: | 0.174 |
Respiratory Toxicity: | 0.048 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002328 | ![]() |
0.387 | D0P0HT | ![]() |
0.230 | ||
ENC002329 | ![]() |
0.387 | D0I2SD | ![]() |
0.226 | ||
ENC005217 | ![]() |
0.364 | D04GJN | ![]() |
0.226 | ||
ENC004965 | ![]() |
0.360 | D06AEO | ![]() |
0.218 | ||
ENC004966 | ![]() |
0.360 | D0G6AB | ![]() |
0.213 | ||
ENC005025 | ![]() |
0.347 | D02CNR | ![]() |
0.204 | ||
ENC005579 | ![]() |
0.320 | D0H6VY | ![]() |
0.203 | ||
ENC004059 | ![]() |
0.303 | D0I5DS | ![]() |
0.200 | ||
ENC004167 | ![]() |
0.302 | D08PIQ | ![]() |
0.200 | ||
ENC004168 | ![]() |
0.302 | D0U4VT | ![]() |
0.200 |