![]() |
Name |
diaporchromanone D
|
Molecular Formula | C16H18O8 | |
IUPAC Name* |
methyl8-hydroxy-3-(1-hydroxy-3-oxobutyl)-7-methoxy-4-oxo-2,3-dihydrochromene-5-carboxylate
|
|
SMILES |
COC(=O)c1cc(OC)c(O)c2c1C(=O)C(C(O)CC(C)=O)CO2
|
|
InChI |
InChI=1S/C16H18O8/c1-7(17)4-10(18)9-6-24-15-12(13(9)19)8(16(21)23-3)5-11(22-2)14(15)20/h5,9-10,18,20H,4,6H2,1-3H3/t9-,10-/m0/s1
|
|
InChIKey |
AOKKLGRSAUZHNS-UWVGGRQHSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 338.31 | ALogp: | 0.7 |
HBD: | 2 | HBA: | 8 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 119.4 | Aromatic Rings: | 2 |
Heavy Atoms: | 24 | QED Weighted: | 0.767 |
Caco-2 Permeability: | -5.067 | MDCK Permeability: | 0.00000476 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.99 |
Human Intestinal Absorption (HIA): | 0.439 | 20% Bioavailability (F20%): | 0.022 |
30% Bioavailability (F30%): | 0.021 |
Blood-Brain-Barrier Penetration (BBB): | 0.138 | Plasma Protein Binding (PPB): | 75.87% |
Volume Distribution (VD): | 1.172 | Fu: | 29.72% |
CYP1A2-inhibitor: | 0.036 | CYP1A2-substrate: | 0.909 |
CYP2C19-inhibitor: | 0.015 | CYP2C19-substrate: | 0.76 |
CYP2C9-inhibitor: | 0.01 | CYP2C9-substrate: | 0.356 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.226 |
CYP3A4-inhibitor: | 0.007 | CYP3A4-substrate: | 0.244 |
Clearance (CL): | 5.055 | Half-life (T1/2): | 0.822 |
hERG Blockers: | 0.05 | Human Hepatotoxicity (H-HT): | 0.286 |
Drug-inuced Liver Injury (DILI): | 0.564 | AMES Toxicity: | 0.104 |
Rat Oral Acute Toxicity: | 0.43 | Maximum Recommended Daily Dose: | 0.702 |
Skin Sensitization: | 0.657 | Carcinogencity: | 0.098 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.03 |
Respiratory Toxicity: | 0.052 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D00WVW | ![]() |
0.254 | ||||
![]() |
D0C1SF | ![]() |
0.252 | ||||
![]() |
D0F7CS | ![]() |
0.248 | ||||
![]() |
D0A1DH | ![]() |
0.241 | ||||
![]() |
D04OSE | ![]() |
0.236 | ||||
![]() |
D06GCK | ![]() |
0.231 | ||||
![]() |
D09DHY | ![]() |
0.231 | ||||
![]() |
D0S5CU | ![]() |
0.230 | ||||
![]() |
D06TQZ | ![]() |
0.229 | ||||
![]() |
D02XJY | ![]() |
0.228 |