|
Name |
phomochromenone D
|
Molecular Formula | C16H18O6 | |
IUPAC Name* |
methyl2-(2-hydroxypropyl)-7-methoxy-3-methyl-4-oxochromene-5-carboxylate
|
|
SMILES |
COC(=O)c1cc(OC)cc2oc(CC(C)O)c(C)c(=O)c12
|
|
InChI |
InChI=1S/C16H18O6/c1-8(17)5-12-9(2)15(18)14-11(16(19)21-4)6-10(20-3)7-13(14)22-12/h6-8,17H,5H2,1-4H3/t8-/m0/s1
|
|
InChIKey |
KGUYWHUTYXMUPT-QMMMGPOBSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 306.31 | ALogp: | 1.8 |
HBD: | 1 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 86.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 22 | QED Weighted: | 0.873 |
Caco-2 Permeability: | -4.769 | MDCK Permeability: | 0.00003220 |
Pgp-inhibitor: | 0.016 | Pgp-substrate: | 0.173 |
Human Intestinal Absorption (HIA): | 0.015 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.233 |
Blood-Brain-Barrier Penetration (BBB): | 0.356 | Plasma Protein Binding (PPB): | 77.35% |
Volume Distribution (VD): | 0.927 | Fu: | 14.94% |
CYP1A2-inhibitor: | 0.946 | CYP1A2-substrate: | 0.965 |
CYP2C19-inhibitor: | 0.784 | CYP2C19-substrate: | 0.682 |
CYP2C9-inhibitor: | 0.631 | CYP2C9-substrate: | 0.871 |
CYP2D6-inhibitor: | 0.086 | CYP2D6-substrate: | 0.782 |
CYP3A4-inhibitor: | 0.229 | CYP3A4-substrate: | 0.222 |
Clearance (CL): | 5.591 | Half-life (T1/2): | 0.654 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.789 |
Drug-inuced Liver Injury (DILI): | 0.888 | AMES Toxicity: | 0.302 |
Rat Oral Acute Toxicity: | 0.029 | Maximum Recommended Daily Dose: | 0.156 |
Skin Sensitization: | 0.18 | Carcinogencity: | 0.02 |
Eye Corrosion: | 0.006 | Eye Irritation: | 0.17 |
Respiratory Toxicity: | 0.077 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004950 | 0.667 | D0O6KE | 0.287 | ||||
ENC004951 | 0.667 | D0G5UB | 0.280 | ||||
ENC003860 | 0.595 | D0G4KG | 0.273 | ||||
ENC003136 | 0.564 | D06GCK | 0.267 | ||||
ENC003543 | 0.558 | D02XJY | 0.256 | ||||
ENC005167 | 0.494 | D0Z7KE | 0.255 | ||||
ENC001636 | 0.478 | D09GYT | 0.253 | ||||
ENC005903 | 0.468 | D01XNB | 0.248 | ||||
ENC003814 | 0.459 | D0C6DT | 0.248 | ||||
ENC002197 | 0.442 | D0WN0U | 0.248 |