![]() |
Name |
aspergiamide D
|
Molecular Formula | C21H25N3O3 | |
IUPAC Name* |
3-[hydroxy-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
|
|
SMILES |
C=CC(C)(C)c1[nH]c2ccccc2c1C(O)C1NC(=O)C2CCCN2C1=O
|
|
InChI |
InChI=1S/C21H25N3O3/c1-4-21(2,3)18-15(12-8-5-6-9-13(12)22-18)17(25)16-20(27)24-11-7-10-14(24)19(26)23-16/h4-6,8-9,14,16-17,22,25H,1,7,10-11H2,2-3H3,(H,23,26)/t14-,16-,17+/m0/s1
|
|
InChIKey |
HHISXAMXDOTYRX-BHYGNILZSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 367.45 | ALogp: | 2.2 |
HBD: | 3 | HBA: | 3 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 85.4 | Aromatic Rings: | 4 |
Heavy Atoms: | 27 | QED Weighted: | 0.727 |
Caco-2 Permeability: | -5.069 | MDCK Permeability: | 0.00001540 |
Pgp-inhibitor: | 0.908 | Pgp-substrate: | 0.034 |
Human Intestinal Absorption (HIA): | 0.063 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.004 |
Blood-Brain-Barrier Penetration (BBB): | 0.678 | Plasma Protein Binding (PPB): | 87.63% |
Volume Distribution (VD): | 1.428 | Fu: | 13.09% |
CYP1A2-inhibitor: | 0.144 | CYP1A2-substrate: | 0.433 |
CYP2C19-inhibitor: | 0.145 | CYP2C19-substrate: | 0.37 |
CYP2C9-inhibitor: | 0.063 | CYP2C9-substrate: | 0.574 |
CYP2D6-inhibitor: | 0.394 | CYP2D6-substrate: | 0.861 |
CYP3A4-inhibitor: | 0.596 | CYP3A4-substrate: | 0.613 |
Clearance (CL): | 1.94 | Half-life (T1/2): | 0.338 |
hERG Blockers: | 0.042 | Human Hepatotoxicity (H-HT): | 0.193 |
Drug-inuced Liver Injury (DILI): | 0.365 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.894 | Maximum Recommended Daily Dose: | 0.853 |
Skin Sensitization: | 0.065 | Carcinogencity: | 0.107 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.967 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004930 | ![]() |
0.821 | D05MQK | ![]() |
0.293 | ||
ENC004933 | ![]() |
0.721 | D01JGV | ![]() |
0.282 | ||
ENC000981 | ![]() |
0.721 | D0U7GP | ![]() |
0.282 | ||
ENC004439 | ![]() |
0.663 | D0H4JM | ![]() |
0.282 | ||
ENC002925 | ![]() |
0.626 | D0U7GK | ![]() |
0.280 | ||
ENC004932 | ![]() |
0.626 | D08VRO | ![]() |
0.274 | ||
ENC001926 | ![]() |
0.520 | D0Q5NX | ![]() |
0.267 | ||
ENC004928 | ![]() |
0.515 | D02IQY | ![]() |
0.260 | ||
ENC004610 | ![]() |
0.495 | D01TSI | ![]() |
0.253 | ||
ENC000975 | ![]() |
0.495 | D06YFA | ![]() |
0.252 |