![]() |
Name |
aspergiamide A
|
Molecular Formula | C21H25N3O3 | |
IUPAC Name* |
3-(3-hydroxypropyl)-6-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methylidene]piperazine-2,5-dione
|
|
SMILES |
C=CC(C)(C)c1[nH]c2ccccc2c1C=C1NC(=O)C(CCCO)NC1=O
|
|
InChI |
InChI=1S/C21H25N3O3/c1-4-21(2,3)18-14(13-8-5-6-9-15(13)22-18)12-17-20(27)23-16(10-7-11-25)19(26)24-17/h4-6,8-9,12,16,22,25H,1,7,10-11H2,2-3H3,(H,23,27)(H,24,26)/b17-12-/t16-/m1/s1
|
|
InChIKey |
PXNVGXZLUCZOTE-WISAJEAXSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 367.45 | ALogp: | 2.4 |
HBD: | 4 | HBA: | 3 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 94.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 27 | QED Weighted: | 0.467 |
Caco-2 Permeability: | -5.227 | MDCK Permeability: | 0.00001550 |
Pgp-inhibitor: | 0.985 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.866 |
30% Bioavailability (F30%): | 0.007 |
Blood-Brain-Barrier Penetration (BBB): | 0.035 | Plasma Protein Binding (PPB): | 97.59% |
Volume Distribution (VD): | 0.442 | Fu: | 2.04% |
CYP1A2-inhibitor: | 0.162 | CYP1A2-substrate: | 0.794 |
CYP2C19-inhibitor: | 0.184 | CYP2C19-substrate: | 0.055 |
CYP2C9-inhibitor: | 0.407 | CYP2C9-substrate: | 0.779 |
CYP2D6-inhibitor: | 0.43 | CYP2D6-substrate: | 0.319 |
CYP3A4-inhibitor: | 0.698 | CYP3A4-substrate: | 0.583 |
Clearance (CL): | 3.543 | Half-life (T1/2): | 0.858 |
hERG Blockers: | 0.03 | Human Hepatotoxicity (H-HT): | 0.388 |
Drug-inuced Liver Injury (DILI): | 0.963 | AMES Toxicity: | 0.01 |
Rat Oral Acute Toxicity: | 0.718 | Maximum Recommended Daily Dose: | 0.04 |
Skin Sensitization: | 0.109 | Carcinogencity: | 0.032 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
Respiratory Toxicity: | 0.983 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002895 | ![]() |
0.846 | D01PZD | ![]() |
0.286 | ||
ENC004927 | ![]() |
0.810 | D0E3SH | ![]() |
0.261 | ||
ENC005569 | ![]() |
0.741 | D0W7WC | ![]() |
0.254 | ||
ENC001957 | ![]() |
0.741 | D0AV3G | ![]() |
0.237 | ||
ENC002717 | ![]() |
0.644 | D08VRO | ![]() |
0.234 | ||
ENC002459 | ![]() |
0.604 | D06ZPS | ![]() |
0.233 | ||
ENC004928 | ![]() |
0.596 | D05MQK | ![]() |
0.233 | ||
ENC004932 | ![]() |
0.591 | D0Y7RW | ![]() |
0.232 | ||
ENC002925 | ![]() |
0.591 | D0H5MB | ![]() |
0.232 | ||
ENC004440 | ![]() |
0.551 | D05EPM | ![]() |
0.232 |