|
Name |
18-metoxycytochalasin J
|
Molecular Formula | C29H39NO4 | |
IUPAC Name* |
16-benzyl-2,12-dihydroxy-5-methoxy-5,7,14-trimethyl-13-methylidene-17-azatricyclo[9.7.0.01,15]octadeca-3,9-dien-18-one
|
|
SMILES |
C=C1C(C)C2C(Cc3ccccc3)NC(=O)C23C(O)C=CC(C)(OC)CC(C)CC=CC3C1O
|
|
InChI |
InChI=1S/C29H39NO4/c1-18-10-9-13-22-26(32)20(3)19(2)25-23(16-21-11-7-6-8-12-21)30-27(33)29(22,25)24(31)14-15-28(4,17-18)34-5/h6-9,11-15,18-19,22-26,31-32H,3,10,16-17H2,1-2,4-5H3,(H,30,33)/b13-9+,15-14+/t18-,19+,22+,23-,24+,25?,26+,28-,29+/m0/s1
|
|
InChIKey |
LIZLHKYMYYPMJW-DHSLCVIJSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 465.63 | ALogp: | 3.8 |
HBD: | 3 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 78.8 | Aromatic Rings: | 4 |
Heavy Atoms: | 34 | QED Weighted: | 0.575 |
Caco-2 Permeability: | -4.889 | MDCK Permeability: | 0.00010988 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.01 |
Human Intestinal Absorption (HIA): | 0.162 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.014 |
Blood-Brain-Barrier Penetration (BBB): | 0.951 | Plasma Protein Binding (PPB): | 91.27% |
Volume Distribution (VD): | 1.856 | Fu: | 8.52% |
CYP1A2-inhibitor: | 0.021 | CYP1A2-substrate: | 0.589 |
CYP2C19-inhibitor: | 0.139 | CYP2C19-substrate: | 0.815 |
CYP2C9-inhibitor: | 0.139 | CYP2C9-substrate: | 0.248 |
CYP2D6-inhibitor: | 0.036 | CYP2D6-substrate: | 0.378 |
CYP3A4-inhibitor: | 0.919 | CYP3A4-substrate: | 0.592 |
Clearance (CL): | 9.176 | Half-life (T1/2): | 0.026 |
hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.047 |
Drug-inuced Liver Injury (DILI): | 0.026 | AMES Toxicity: | 0.021 |
Rat Oral Acute Toxicity: | 0.827 | Maximum Recommended Daily Dose: | 0.592 |
Skin Sensitization: | 0.029 | Carcinogencity: | 0.083 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.945 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004544 | 1.000 | D06CWH | 0.270 | ||||
ENC004243 | 0.850 | D0I0DL | 0.244 | ||||
ENC006133 | 0.760 | D05VQI | 0.242 | ||||
ENC005134 | 0.757 | D0IN7I | 0.241 | ||||
ENC004468 | 0.739 | D0SP3D | 0.240 | ||||
ENC004370 | 0.729 | D0V3ZA | 0.240 | ||||
ENC003955 | 0.710 | D0D7KC | 0.240 | ||||
ENC004369 | 0.697 | D09NNH | 0.233 | ||||
ENC004120 | 0.691 | D01TSI | 0.233 | ||||
ENC003170 | 0.670 | D0H6TP | 0.232 |