![]() |
Name |
(3E,8E,6S)-undeca-3,8,10-triene-1,6-diol
|
Molecular Formula | C15H18O8 | |
IUPAC Name* |
7-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-5-hydroxy-2-methyl-2,3-dihydrochromen-4-one
|
|
SMILES |
CC1CC(=O)c2c(O)cc(OC3OC(CO)C(O)C3O)cc2O1
|
|
InChI |
InChI=1S/C15H18O8/c1-6-2-8(17)12-9(18)3-7(4-10(12)21-6)22-15-14(20)13(19)11(5-16)23-15/h3-4,6,11,13-16,18-20H,2,5H2,1H3/t6?,11-,13?,14-,15+/m1/s1
|
|
InChIKey |
ZCLIKZVRIIQMIP-RVVNHPEISA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 326.3 | ALogp: | -0.4 |
HBD: | 4 | HBA: | 8 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 125.7 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.612 |
Caco-2 Permeability: | -5.953 | MDCK Permeability: | 0.00008530 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.019 |
Human Intestinal Absorption (HIA): | 0.223 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.885 |
Blood-Brain-Barrier Penetration (BBB): | 0.709 | Plasma Protein Binding (PPB): | 63.13% |
Volume Distribution (VD): | 0.758 | Fu: | 28.42% |
CYP1A2-inhibitor: | 0.052 | CYP1A2-substrate: | 0.067 |
CYP2C19-inhibitor: | 0.019 | CYP2C19-substrate: | 0.398 |
CYP2C9-inhibitor: | 0.003 | CYP2C9-substrate: | 0.449 |
CYP2D6-inhibitor: | 0.142 | CYP2D6-substrate: | 0.294 |
CYP3A4-inhibitor: | 0.017 | CYP3A4-substrate: | 0.111 |
Clearance (CL): | 6.122 | Half-life (T1/2): | 0.384 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.083 |
Drug-inuced Liver Injury (DILI): | 0.937 | AMES Toxicity: | 0.414 |
Rat Oral Acute Toxicity: | 0.078 | Maximum Recommended Daily Dose: | 0.042 |
Skin Sensitization: | 0.066 | Carcinogencity: | 0.941 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.019 |
Respiratory Toxicity: | 0.269 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D0I9HF | ![]() |
0.437 | ||||
![]() |
D06BQU | ![]() |
0.372 | ||||
![]() |
D07MGA | ![]() |
0.319 | ||||
![]() |
D0Y7DP | ![]() |
0.313 | ||||
![]() |
D07XSN | ![]() |
0.313 | ||||
![]() |
D05ZYM | ![]() |
0.308 | ||||
![]() |
D0G5AG | ![]() |
0.306 | ||||
![]() |
D0H2RI | ![]() |
0.306 | ||||
![]() |
D07NSU | ![]() |
0.306 | ||||
![]() |
D0H3KI | ![]() |
0.306 |