![]() |
Name |
asterriquinol D syringic acid
|
Molecular Formula | C9H10O5 | |
IUPAC Name* |
4-hydroxy-3,5-dimethoxybenzoicacid
|
|
SMILES |
COc1cc(C(=O)O)cc(OC)c1O
|
|
InChI |
InChI=1S/C9H10O5/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,10H,1-2H3,(H,11,12)
|
|
InChIKey |
JMSVCTWVEWCHDZ-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 198.17 | ALogp: | 1.1 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 76.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 14 | QED Weighted: | 0.77 |
Caco-2 Permeability: | -5.142 | MDCK Permeability: | 0.00001090 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.028 | 20% Bioavailability (F20%): | 0.011 |
30% Bioavailability (F30%): | 0.067 |
Blood-Brain-Barrier Penetration (BBB): | 0.457 | Plasma Protein Binding (PPB): | 50.89% |
Volume Distribution (VD): | 0.459 | Fu: | 38.57% |
CYP1A2-inhibitor: | 0.032 | CYP1A2-substrate: | 0.911 |
CYP2C19-inhibitor: | 0.025 | CYP2C19-substrate: | 0.058 |
CYP2C9-inhibitor: | 0.028 | CYP2C9-substrate: | 0.131 |
CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.141 |
CYP3A4-inhibitor: | 0.016 | CYP3A4-substrate: | 0.071 |
Clearance (CL): | 7.208 | Half-life (T1/2): | 0.946 |
hERG Blockers: | 0.034 | Human Hepatotoxicity (H-HT): | 0.154 |
Drug-inuced Liver Injury (DILI): | 0.795 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.011 | Maximum Recommended Daily Dose: | 0.023 |
Skin Sensitization: | 0.129 | Carcinogencity: | 0.034 |
Eye Corrosion: | 0.292 | Eye Irritation: | 0.977 |
Respiratory Toxicity: | 0.044 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D0E6OC | ![]() |
0.316 | ||||
![]() |
D06GCK | ![]() |
0.309 | ||||
![]() |
D02XJY | ![]() |
0.303 | ||||
![]() |
D0A8FB | ![]() |
0.292 | ||||
![]() |
D0E9CD | ![]() |
0.288 | ||||
![]() |
D09GYT | ![]() |
0.283 | ||||
![]() |
D0N1FS | ![]() |
0.279 | ||||
![]() |
D06QKV | ![]() |
0.278 | ||||
![]() |
D0Q9ON | ![]() |
0.275 | ||||
![]() |
D06TQZ | ![]() |
0.274 |