![]() |
Name |
(3S,4R,6aS,10aR)-4-hydroxy-7,7,10a-trimethyl-5,6,7,10a-tetrahydro-3H-3,6a-methanobenzo[c][1,2]dioxocin-10(4H)-one
|
Molecular Formula | C14H20O4 | |
IUPAC Name* |
9-hydroxy-2,2,6-trimethyl-7,8-dioxatricyclo[6.3.1.01,6]dodec-3-en-5-one
|
|
SMILES |
CC1(C)C=CC(=O)C2(C)OOC3CC12CCC3O
|
|
InChI |
InChI=1S/C14H20O4/c1-12(2)6-5-11(16)13(3)14(12)7-4-9(15)10(8-14)17-18-13/h5-6,9-10,15H,4,7-8H2,1-3H3/t9?,10?,13-,14?/m0/s1
|
|
InChIKey |
JWSNYZFGMPURDW-WYZDFKRPSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 252.31 | ALogp: | 1.8 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 55.8 | Aromatic Rings: | 3 |
Heavy Atoms: | 18 | QED Weighted: | 0.672 |
Caco-2 Permeability: | -4.618 | MDCK Permeability: | 0.00003090 |
Pgp-inhibitor: | 0.016 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.01 |
30% Bioavailability (F30%): | 0.004 |
Blood-Brain-Barrier Penetration (BBB): | 0.508 | Plasma Protein Binding (PPB): | 77.90% |
Volume Distribution (VD): | 1.647 | Fu: | 30.33% |
CYP1A2-inhibitor: | 0.018 | CYP1A2-substrate: | 0.838 |
CYP2C19-inhibitor: | 0.078 | CYP2C19-substrate: | 0.895 |
CYP2C9-inhibitor: | 0.04 | CYP2C9-substrate: | 0.19 |
CYP2D6-inhibitor: | 0.014 | CYP2D6-substrate: | 0.303 |
CYP3A4-inhibitor: | 0.071 | CYP3A4-substrate: | 0.86 |
Clearance (CL): | 7.365 | Half-life (T1/2): | 0.372 |
hERG Blockers: | 0.039 | Human Hepatotoxicity (H-HT): | 0.368 |
Drug-inuced Liver Injury (DILI): | 0.046 | AMES Toxicity: | 0.388 |
Rat Oral Acute Toxicity: | 0.848 | Maximum Recommended Daily Dose: | 0.906 |
Skin Sensitization: | 0.375 | Carcinogencity: | 0.945 |
Eye Corrosion: | 0.006 | Eye Irritation: | 0.24 |
Respiratory Toxicity: | 0.902 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004436 | ![]() |
0.607 | D0H1QY | ![]() |
0.279 | ||
ENC002905 | ![]() |
0.607 | D02JNM | ![]() |
0.272 | ||
ENC003898 | ![]() |
0.417 | D08PIQ | ![]() |
0.271 | ||
ENC003910 | ![]() |
0.365 | D0D2TN | ![]() |
0.271 | ||
ENC002907 | ![]() |
0.338 | D0D1SG | ![]() |
0.263 | ||
ENC004718 | ![]() |
0.338 | D0P0HT | ![]() |
0.260 | ||
ENC003409 | ![]() |
0.322 | D0V9DZ | ![]() |
0.258 | ||
ENC002546 | ![]() |
0.317 | D0L2LS | ![]() |
0.253 | ||
ENC002547 | ![]() |
0.317 | D0Y7IU | ![]() |
0.250 | ||
ENC000481 | ![]() |
0.300 | D04QNO | ![]() |
0.250 |