![]() |
Name |
methyl 5-phenyl-4-oxopentanoate
|
Molecular Formula | C11H12O3 | |
IUPAC Name* |
4-oxo-5-phenylpentanoicacid
|
|
SMILES |
O=C(O)CCC(=O)Cc1ccccc1
|
|
InChI |
InChI=1S/C11H12O3/c12-10(6-7-11(13)14)8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,13,14)
|
|
InChIKey |
LTNSOYZGFPWHOF-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 192.21 | ALogp: | 1.7 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 54.4 | Aromatic Rings: | 1 |
Heavy Atoms: | 14 | QED Weighted: | 0.778 |
Caco-2 Permeability: | -5.273 | MDCK Permeability: | 0.00003500 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.091 |
Human Intestinal Absorption (HIA): | 0.012 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.001 |
Blood-Brain-Barrier Penetration (BBB): | 0.181 | Plasma Protein Binding (PPB): | 54.47% |
Volume Distribution (VD): | 0.193 | Fu: | 36.88% |
CYP1A2-inhibitor: | 0.023 | CYP1A2-substrate: | 0.073 |
CYP2C19-inhibitor: | 0.022 | CYP2C19-substrate: | 0.063 |
CYP2C9-inhibitor: | 0.015 | CYP2C9-substrate: | 0.912 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.258 |
CYP3A4-inhibitor: | 0.006 | CYP3A4-substrate: | 0.121 |
Clearance (CL): | 7.58 | Half-life (T1/2): | 0.925 |
hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.243 |
Drug-inuced Liver Injury (DILI): | 0.913 | AMES Toxicity: | 0.332 |
Rat Oral Acute Toxicity: | 0.052 | Maximum Recommended Daily Dose: | 0.014 |
Skin Sensitization: | 0.406 | Carcinogencity: | 0.038 |
Eye Corrosion: | 0.228 | Eye Irritation: | 0.712 |
Respiratory Toxicity: | 0.038 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D07ONP | ![]() |
0.531 | ||||
![]() |
D0P2GK | ![]() |
0.480 | ||||
![]() |
D0R1CR | ![]() |
0.469 | ||||
![]() |
D00DZN | ![]() |
0.462 | ||||
![]() |
D06LHG | ![]() |
0.453 | ||||
![]() |
D05OIS | ![]() |
0.442 | ||||
![]() |
D0Y7ZD | ![]() |
0.409 | ||||
![]() |
D0O4GY | ![]() |
0.400 | ||||
![]() |
D0Y7EM | ![]() |
0.393 | ||||
![]() |
D05OFX | ![]() |
0.391 |