![]() |
Name |
isobutyl (S)-2,4-dihydroxy-6-(8-hydroxynonyl)benzoate
|
Molecular Formula | C20H32O5 | |
IUPAC Name* |
2-methylpropyl2,4-dihydroxy-6-(8-hydroxynonyl)benzoate
|
|
SMILES |
CC(C)COC(=O)c1c(O)cc(O)cc1CCCCCCCC(C)O
|
|
InChI |
InChI=1S/C20H32O5/c1-14(2)13-25-20(24)19-16(11-17(22)12-18(19)23)10-8-6-4-5-7-9-15(3)21/h11-12,14-15,21-23H,4-10,13H2,1-3H3/t15-/m0/s1
|
|
InChIKey |
WZYBWVAXVMWOOW-HNNXBMFYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 352.47 | ALogp: | 4.2 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 11 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 87.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 25 | QED Weighted: | 0.395 |
Caco-2 Permeability: | -4.819 | MDCK Permeability: | 0.00002430 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.014 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.992 |
30% Bioavailability (F30%): | 0.062 |
Blood-Brain-Barrier Penetration (BBB): | 0.365 | Plasma Protein Binding (PPB): | 97.36% |
Volume Distribution (VD): | 0.924 | Fu: | 2.61% |
CYP1A2-inhibitor: | 0.921 | CYP1A2-substrate: | 0.342 |
CYP2C19-inhibitor: | 0.857 | CYP2C19-substrate: | 0.109 |
CYP2C9-inhibitor: | 0.604 | CYP2C9-substrate: | 0.973 |
CYP2D6-inhibitor: | 0.889 | CYP2D6-substrate: | 0.237 |
CYP3A4-inhibitor: | 0.486 | CYP3A4-substrate: | 0.097 |
Clearance (CL): | 9.947 | Half-life (T1/2): | 0.78 |
hERG Blockers: | 0.054 | Human Hepatotoxicity (H-HT): | 0.031 |
Drug-inuced Liver Injury (DILI): | 0.146 | AMES Toxicity: | 0.058 |
Rat Oral Acute Toxicity: | 0.011 | Maximum Recommended Daily Dose: | 0.131 |
Skin Sensitization: | 0.925 | Carcinogencity: | 0.036 |
Eye Corrosion: | 0.012 | Eye Irritation: | 0.932 |
Respiratory Toxicity: | 0.412 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004669 | ![]() |
0.819 | D0G2KD | ![]() |
0.313 | ||
ENC003741 | ![]() |
0.819 | D0P1RL | ![]() |
0.287 | ||
ENC004666 | ![]() |
0.740 | D0D9NY | ![]() |
0.272 | ||
ENC004667 | ![]() |
0.662 | D0L5YV | ![]() |
0.270 | ||
ENC004670 | ![]() |
0.658 | D0MM8N | ![]() |
0.264 | ||
ENC004818 | ![]() |
0.633 | D02UFG | ![]() |
0.256 | ||
ENC004668 | ![]() |
0.625 | D03LGG | ![]() |
0.252 | ||
ENC004665 | ![]() |
0.623 | D0U5CE | ![]() |
0.252 | ||
ENC003972 | ![]() |
0.617 | D00FSV | ![]() |
0.252 | ||
ENC003189 | ![]() |
0.547 | D0I4DQ | ![]() |
0.245 |