![]() |
Name |
Daldiniol A
|
Molecular Formula | C12H12O3 | |
IUPAC Name* |
4-[5-(hydroxymethyl)-2-methoxyphenyl]but-3-yn-2-one
|
|
SMILES |
COc1ccc(CO)cc1C#CC(C)=O
|
|
InChI |
InChI=1S/C12H12O3/c1-9(14)3-5-11-7-10(8-13)4-6-12(11)15-2/h4,6-7,13H,8H2,1-2H3
|
|
InChIKey |
YACSZJBEOMHRBB-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 204.22 | ALogp: | 1.1 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.744 |
Caco-2 Permeability: | -4.311 | MDCK Permeability: | 0.00001560 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.011 |
30% Bioavailability (F30%): | 0.2 |
Blood-Brain-Barrier Penetration (BBB): | 0.571 | Plasma Protein Binding (PPB): | 68.39% |
Volume Distribution (VD): | 0.93 | Fu: | 11.83% |
CYP1A2-inhibitor: | 0.795 | CYP1A2-substrate: | 0.87 |
CYP2C19-inhibitor: | 0.792 | CYP2C19-substrate: | 0.791 |
CYP2C9-inhibitor: | 0.449 | CYP2C9-substrate: | 0.77 |
CYP2D6-inhibitor: | 0.03 | CYP2D6-substrate: | 0.804 |
CYP3A4-inhibitor: | 0.144 | CYP3A4-substrate: | 0.546 |
Clearance (CL): | 8.382 | Half-life (T1/2): | 0.842 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.033 |
Drug-inuced Liver Injury (DILI): | 0.846 | AMES Toxicity: | 0.634 |
Rat Oral Acute Toxicity: | 0.251 | Maximum Recommended Daily Dose: | 0.117 |
Skin Sensitization: | 0.932 | Carcinogencity: | 0.775 |
Eye Corrosion: | 0.822 | Eye Irritation: | 0.989 |
Respiratory Toxicity: | 0.975 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004656 | ![]() |
0.783 | D0E9CD | ![]() |
0.340 | ||
ENC004652 | ![]() |
0.640 | D02XJY | ![]() |
0.324 | ||
ENC004653 | ![]() |
0.604 | D05CKR | ![]() |
0.309 | ||
ENC004655 | ![]() |
0.519 | D0U0OT | ![]() |
0.306 | ||
ENC004654 | ![]() |
0.459 | D0C6OQ | ![]() |
0.302 | ||
ENC004657 | ![]() |
0.419 | D03LGG | ![]() |
0.291 | ||
ENC002891 | ![]() |
0.382 | D0U5CE | ![]() |
0.291 | ||
ENC000478 | ![]() |
0.382 | D09GYT | ![]() |
0.286 | ||
ENC000777 | ![]() |
0.382 | D0Y6KO | ![]() |
0.279 | ||
ENC001055 | ![]() |
0.377 | D0AN7B | ![]() |
0.271 |