![]() |
Name |
Isoaspergilline D
|
Molecular Formula | C22H21N3O3 | |
IUPAC Name* |
4-benzyl-1-butan-2-ylidene-10-hydroxy-4H-pyrazino[2,1-b]quinazoline-3,6-dione
|
|
SMILES |
CCC(C)=C1NC(=O)C(Cc2ccccc2)n2c1nc1c(O)cccc1c2=O
|
|
InChI |
InChI=1S/C22H21N3O3/c1-3-13(2)18-20-23-19-15(10-7-11-17(19)26)22(28)25(20)16(21(27)24-18)12-14-8-5-4-6-9-14/h4-11,16,26H,3,12H2,1-2H3,(H,24,27)/b18-13-/t16-/m1/s1
|
|
InChIKey |
FZKQHPXFSGQFMI-OKSBFYSISA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 375.43 | ALogp: | 3.2 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 84.2 | Aromatic Rings: | 4 |
Heavy Atoms: | 28 | QED Weighted: | 0.726 |
Caco-2 Permeability: | -4.804 | MDCK Permeability: | 0.00002930 |
Pgp-inhibitor: | 0.194 | Pgp-substrate: | 0.013 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.008 |
30% Bioavailability (F30%): | 0.001 |
Blood-Brain-Barrier Penetration (BBB): | 0.037 | Plasma Protein Binding (PPB): | 97.95% |
Volume Distribution (VD): | 0.409 | Fu: | 0.96% |
CYP1A2-inhibitor: | 0.88 | CYP1A2-substrate: | 0.772 |
CYP2C19-inhibitor: | 0.74 | CYP2C19-substrate: | 0.122 |
CYP2C9-inhibitor: | 0.924 | CYP2C9-substrate: | 0.395 |
CYP2D6-inhibitor: | 0.808 | CYP2D6-substrate: | 0.159 |
CYP3A4-inhibitor: | 0.856 | CYP3A4-substrate: | 0.811 |
Clearance (CL): | 4.615 | Half-life (T1/2): | 0.756 |
hERG Blockers: | 0.039 | Human Hepatotoxicity (H-HT): | 0.44 |
Drug-inuced Liver Injury (DILI): | 0.942 | AMES Toxicity: | 0.326 |
Rat Oral Acute Toxicity: | 0.374 | Maximum Recommended Daily Dose: | 0.94 |
Skin Sensitization: | 0.046 | Carcinogencity: | 0.924 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.055 |
Respiratory Toxicity: | 0.51 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004608 | ![]() |
1.000 | D0E3OF | ![]() |
0.333 | ||
ENC004605 | ![]() |
0.773 | D0QV5T | ![]() |
0.324 | ||
ENC004646 | ![]() |
0.773 | D0P3JU | ![]() |
0.318 | ||
ENC004606 | ![]() |
0.773 | D06ZPS | ![]() |
0.313 | ||
ENC004609 | ![]() |
0.649 | D09LDR | ![]() |
0.308 | ||
ENC002940 | ![]() |
0.574 | D02TJS | ![]() |
0.304 | ||
ENC004647 | ![]() |
0.560 | D01TSI | ![]() |
0.303 | ||
ENC004267 | ![]() |
0.515 | D0J6WW | ![]() |
0.302 | ||
ENC003272 | ![]() |
0.510 | D0B1FE | ![]() |
0.299 | ||
ENC004645 | ![]() |
0.509 | D0O7SP | ![]() |
0.298 |