![]() |
Name |
Musaolide H
|
Molecular Formula | C16H26O3 | |
IUPAC Name* |
2-ethyl-3-hydroxy-2-methyl-5-(4-methyl-5-propyloxolan-3-ylidene)cyclopentan-1-one
|
|
SMILES |
CCCC1OCC(=C2CC(O)C(C)(CC)C2=O)C1C
|
|
InChI |
InChI=1S/C16H26O3/c1-5-7-13-10(3)12(9-19-13)11-8-14(17)16(4,6-2)15(11)18/h10,13-14,17H,5-9H2,1-4H3/b12-11+/t10-,13-,14-,16+/m0/s1
|
|
InChIKey |
ANKIETMDAHSUJJ-XLVHNPQQSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 266.38 | ALogp: | 2.9 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 19 | QED Weighted: | 0.793 |
Caco-2 Permeability: | -4.478 | MDCK Permeability: | 0.00001860 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.034 |
Human Intestinal Absorption (HIA): | 0.012 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.013 |
Blood-Brain-Barrier Penetration (BBB): | 0.93 | Plasma Protein Binding (PPB): | 71.85% |
Volume Distribution (VD): | 0.83 | Fu: | 31.19% |
CYP1A2-inhibitor: | 0.024 | CYP1A2-substrate: | 0.2 |
CYP2C19-inhibitor: | 0.046 | CYP2C19-substrate: | 0.895 |
CYP2C9-inhibitor: | 0.028 | CYP2C9-substrate: | 0.221 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.16 |
CYP3A4-inhibitor: | 0.649 | CYP3A4-substrate: | 0.765 |
Clearance (CL): | 13.461 | Half-life (T1/2): | 0.452 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.227 |
Drug-inuced Liver Injury (DILI): | 0.217 | AMES Toxicity: | 0.018 |
Rat Oral Acute Toxicity: | 0.798 | Maximum Recommended Daily Dose: | 0.85 |
Skin Sensitization: | 0.032 | Carcinogencity: | 0.968 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.047 |
Respiratory Toxicity: | 0.968 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D05OQJ | ![]() |
0.232 | ||||
![]() |
D0CT4D | ![]() |
0.230 | ||||
![]() |
D0L7AS | ![]() |
0.225 | ||||
![]() |
D0K7LU | ![]() |
0.220 | ||||
![]() |
D06WTZ | ![]() |
0.213 | ||||
![]() |
D0Y7IU | ![]() |
0.212 | ||||
![]() |
D04QNO | ![]() |
0.212 | ||||
![]() |
D0P1FO | ![]() |
0.211 | ||||
![]() |
D0H0ND | ![]() |
0.209 | ||||
![]() |
D00MYT | ![]() |
0.208 |