![]() |
Name |
Pestalopyrone D
|
Molecular Formula | C20H30O5 | |
IUPAC Name* |
(3S,6S,7S)-3-butan-2-yl-6-(3-hydroxybutan-2-yl)-12,13-dimethyl-2,4,11-trioxatricyclo[7.4.0.03,7]trideca-1(9),12-dien-10-one
|
|
SMILES |
CCC(C)[C@@]12[C@@H](CC3=C(O1)C(=C(OC3=O)C)C)[C@@H](CO2)C(C)C(C)O
|
|
InChI |
InChI=1S/C20H30O5/c1-7-10(2)20-17(16(9-23-20)11(3)13(5)21)8-15-18(25-20)12(4)14(6)24-19(15)22/h10-11,13,16-17,21H,7-9H2,1-6H3/t10?,11?,13?,16-,17-,20-/m0/s1
|
|
InChIKey |
FRGOTSKELNMPGK-WCRCRYTBSA-N
|
|
Synonyms |
Pestalopyrone D
|
|
CAS | NA | |
PubChem CID | 156582703 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 350.4 | ALogp: | 3.2 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 65.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 25 | QED Weighted: | 0.889 |
Caco-2 Permeability: | -4.68 | MDCK Permeability: | 0.00001690 |
Pgp-inhibitor: | 0.007 | Pgp-substrate: | 0.055 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.661 |
Blood-Brain-Barrier Penetration (BBB): | 0.351 | Plasma Protein Binding (PPB): | 89.93% |
Volume Distribution (VD): | 2.53 | Fu: | 5.71% |
CYP1A2-inhibitor: | 0.141 | CYP1A2-substrate: | 0.867 |
CYP2C19-inhibitor: | 0.042 | CYP2C19-substrate: | 0.92 |
CYP2C9-inhibitor: | 0.109 | CYP2C9-substrate: | 0.161 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.621 |
CYP3A4-inhibitor: | 0.13 | CYP3A4-substrate: | 0.539 |
Clearance (CL): | 12.529 | Half-life (T1/2): | 0.064 |
hERG Blockers: | 0.054 | Human Hepatotoxicity (H-HT): | 0.921 |
Drug-inuced Liver Injury (DILI): | 0.891 | AMES Toxicity: | 0.014 |
Rat Oral Acute Toxicity: | 0.59 | Maximum Recommended Daily Dose: | 0.024 |
Skin Sensitization: | 0.248 | Carcinogencity: | 0.663 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.012 |
Respiratory Toxicity: | 0.915 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004425 | ![]() |
1.000 | D0L5FY | ![]() |
0.214 | ||
ENC004423 | ![]() |
1.000 | D0L7AS | ![]() |
0.205 | ||
ENC004424 | ![]() |
0.714 | D06XZW | ![]() |
0.195 | ||
ENC002088 | ![]() |
0.318 | D0Z1WA | ![]() |
0.192 | ||
ENC004831 | ![]() |
0.318 | D0P1FO | ![]() |
0.191 | ||
ENC006098 | ![]() |
0.307 | D0Y7LD | ![]() |
0.190 | ||
ENC002560 | ![]() |
0.307 | D09SSC | ![]() |
0.180 | ||
ENC002326 | ![]() |
0.289 | D09PJX | ![]() |
0.180 | ||
ENC004941 | ![]() |
0.284 | D0A4JK | ![]() |
0.178 | ||
ENC006099 | ![]() |
0.283 | D0WY9N | ![]() |
0.174 |