![]() |
Name |
Harzianol J
|
Molecular Formula | C20H30O2 | |
IUPAC Name* |
(1R,4R,5R,8S,9S,11S,14R)-4,8,14,15,15-pentamethyltetracyclo[9.3.1.01,9.05,8]pentadecane-6,12-dione
|
|
SMILES |
C[C@@H]1CC[C@]23[C@@H](CC(=O)[C@H](C2(C)C)C[C@H]3[C@]4([C@@H]1C(=O)C4)C)C
|
|
InChI |
InChI=1S/C20H30O2/c1-11-6-7-20-12(2)8-14(21)13(18(20,3)4)9-16(20)19(5)10-15(22)17(11)19/h11-13,16-17H,6-10H2,1-5H3/t11-,12-,13-,16+,17+,19+,20-/m1/s1
|
|
InChIKey |
LAJFFIPLIOGVIR-PKKSIDJUSA-N
|
|
Synonyms |
Harzianol J
|
|
CAS | NA | |
PubChem CID | 156582619 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 302.5 | ALogp: | 4.0 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 34.1 | Aromatic Rings: | 4 |
Heavy Atoms: | 22 | QED Weighted: | 0.642 |
Caco-2 Permeability: | -4.895 | MDCK Permeability: | 0.00002110 |
Pgp-inhibitor: | 0.27 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.016 |
30% Bioavailability (F30%): | 0.945 |
Blood-Brain-Barrier Penetration (BBB): | 0.938 | Plasma Protein Binding (PPB): | 81.71% |
Volume Distribution (VD): | 1.041 | Fu: | 19.65% |
CYP1A2-inhibitor: | 0.05 | CYP1A2-substrate: | 0.396 |
CYP2C19-inhibitor: | 0.126 | CYP2C19-substrate: | 0.904 |
CYP2C9-inhibitor: | 0.335 | CYP2C9-substrate: | 0.173 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.523 |
CYP3A4-inhibitor: | 0.501 | CYP3A4-substrate: | 0.369 |
Clearance (CL): | 15.763 | Half-life (T1/2): | 0.267 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.239 |
Drug-inuced Liver Injury (DILI): | 0.089 | AMES Toxicity: | 0.01 |
Rat Oral Acute Toxicity: | 0.925 | Maximum Recommended Daily Dose: | 0.831 |
Skin Sensitization: | 0.187 | Carcinogencity: | 0.204 |
Eye Corrosion: | 0.35 | Eye Irritation: | 0.341 |
Respiratory Toxicity: | 0.896 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004409 | ![]() |
0.573 | D0I5DS | ![]() |
0.294 | ||
ENC002886 | ![]() |
0.573 | D04SFH | ![]() |
0.283 | ||
ENC005921 | ![]() |
0.532 | D0D2TN | ![]() |
0.282 | ||
ENC005924 | ![]() |
0.532 | D0Q6NZ | ![]() |
0.276 | ||
ENC006062 | ![]() |
0.398 | D0H1QY | ![]() |
0.275 | ||
ENC004042 | ![]() |
0.388 | D0W2EK | ![]() |
0.275 | ||
ENC004410 | ![]() |
0.372 | D09NNA | ![]() |
0.272 | ||
ENC004227 | ![]() |
0.365 | D0I2SD | ![]() |
0.270 | ||
ENC006063 | ![]() |
0.365 | D0U3GL | ![]() |
0.263 | ||
ENC003477 | ![]() |
0.342 | D0IL7L | ![]() |
0.262 |