![]() |
Name |
6,7,9,10-Tetrahydromutolide
|
Molecular Formula | C14H24O4 | |
IUPAC Name* |
(3E,5S,8S,14R)-5,8-dihydroxy-14-methyl-1-oxacyclotetradec-3-en-2-one
|
|
SMILES |
C[C@@H]1CCCCC[C@@H](CC[C@@H](/C=C/C(=O)O1)O)O
|
|
InChI |
InChI=1S/C14H24O4/c1-11-5-3-2-4-6-12(15)7-8-13(16)9-10-14(17)18-11/h9-13,15-16H,2-8H2,1H3/b10-9+/t11-,12+,13+/m1/s1
|
|
InChIKey |
KKYDBOLPIVXUQZ-MMFGINKMSA-N
|
|
Synonyms |
6,7,9,10-tetrahydromutolide
|
|
CAS | NA | |
PubChem CID | 156582440 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 256.34 | ALogp: | 2.1 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 18 | QED Weighted: | 0.654 |
Caco-2 Permeability: | -4.568 | MDCK Permeability: | 0.00006420 |
Pgp-inhibitor: | 0.988 | Pgp-substrate: | 0.713 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.134 |
30% Bioavailability (F30%): | 0.42 |
Blood-Brain-Barrier Penetration (BBB): | 0.924 | Plasma Protein Binding (PPB): | 54.10% |
Volume Distribution (VD): | 0.648 | Fu: | 46.12% |
CYP1A2-inhibitor: | 0.056 | CYP1A2-substrate: | 0.27 |
CYP2C19-inhibitor: | 0.069 | CYP2C19-substrate: | 0.083 |
CYP2C9-inhibitor: | 0.091 | CYP2C9-substrate: | 0.835 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.177 |
CYP3A4-inhibitor: | 0.072 | CYP3A4-substrate: | 0.113 |
Clearance (CL): | 8.63 | Half-life (T1/2): | 0.914 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.254 |
Drug-inuced Liver Injury (DILI): | 0.145 | AMES Toxicity: | 0.202 |
Rat Oral Acute Toxicity: | 0.005 | Maximum Recommended Daily Dose: | 0.924 |
Skin Sensitization: | 0.799 | Carcinogencity: | 0.2 |
Eye Corrosion: | 0.875 | Eye Irritation: | 0.707 |
Respiratory Toxicity: | 0.052 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D07GRH | ![]() |
0.296 | ||||
![]() |
D04URO | ![]() |
0.286 | ||||
![]() |
D00YWP | ![]() |
0.244 | ||||
![]() |
D0K0EK | ![]() |
0.239 | ||||
![]() |
D06XMU | ![]() |
0.239 | ||||
![]() |
D0M0AM | ![]() |
0.237 | ||||
![]() |
D0P6VV | ![]() |
0.232 | ||||
![]() |
D0L9ZR | ![]() |
0.232 | ||||
![]() |
D08QMX | ![]() |
0.230 | ||||
![]() |
D08VSI | ![]() |
0.229 |