![]() |
Name |
Diaporthichalasin G
|
Molecular Formula | C28H37NO4 | |
IUPAC Name* |
(1S,2R,3E,5S,7S,9E,11S,14S,15R,16S)-2-hydroxy-13-(hydroxymethyl)-16-[(4-hydroxyphenyl)methyl]-5,7,14-trimethyl-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-18-one
|
|
SMILES |
C[C@H]1C/C=C/[C@H]2C=C([C@H]([C@@H]3[C@@]2([C@@H](/C=C/[C@H](C1)C)O)C(=O)N[C@H]3CC4=CC=C(C=C4)O)C)CO
|
|
InChI |
InChI=1S/C28H37NO4/c1-17-5-4-6-22-15-21(16-30)19(3)26-24(14-20-8-10-23(31)11-9-20)29-27(33)28(22,26)25(32)12-7-18(2)13-17/h4,6-12,15,17-19,22,24-26,30-32H,5,13-14,16H2,1-3H3,(H,29,33)/b6-4+,12-7+/t17-,18+,19+,22-,24-,25+,26-,28+/m0/s1
|
|
InChIKey |
SWZWFYJCZKXSQT-IBMIJBHQSA-N
|
|
Synonyms |
Diaporthichalasin G
|
|
CAS | NA | |
PubChem CID | 156582434 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 451.6 | ALogp: | 3.8 |
HBD: | 4 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 89.8 | Aromatic Rings: | 4 |
Heavy Atoms: | 33 | QED Weighted: | 0.512 |
Caco-2 Permeability: | -5.228 | MDCK Permeability: | 0.00000661 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.99 |
Human Intestinal Absorption (HIA): | 0.411 | 20% Bioavailability (F20%): | 0.866 |
30% Bioavailability (F30%): | 0.984 |
Blood-Brain-Barrier Penetration (BBB): | 0.527 | Plasma Protein Binding (PPB): | 91.77% |
Volume Distribution (VD): | 0.702 | Fu: | 1.92% |
CYP1A2-inhibitor: | 0.159 | CYP1A2-substrate: | 0.114 |
CYP2C19-inhibitor: | 0.56 | CYP2C19-substrate: | 0.575 |
CYP2C9-inhibitor: | 0.777 | CYP2C9-substrate: | 0.881 |
CYP2D6-inhibitor: | 0.325 | CYP2D6-substrate: | 0.857 |
CYP3A4-inhibitor: | 0.919 | CYP3A4-substrate: | 0.219 |
Clearance (CL): | 5.185 | Half-life (T1/2): | 0.524 |
hERG Blockers: | 0.177 | Human Hepatotoxicity (H-HT): | 0.287 |
Drug-inuced Liver Injury (DILI): | 0.933 | AMES Toxicity: | 0.121 |
Rat Oral Acute Toxicity: | 0.703 | Maximum Recommended Daily Dose: | 0.988 |
Skin Sensitization: | 0.366 | Carcinogencity: | 0.34 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.98 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004372 | ![]() |
0.829 | D0S2BV | ![]() |
0.264 | ||
ENC004119 | ![]() |
0.743 | D00LFB | ![]() |
0.248 | ||
ENC004118 | ![]() |
0.619 | D0I0DL | ![]() |
0.238 | ||
ENC006133 | ![]() |
0.602 | D04XEG | ![]() |
0.234 | ||
ENC003718 | ![]() |
0.578 | D0J7RK | ![]() |
0.232 | ||
ENC005130 | ![]() |
0.547 | D06ALD | ![]() |
0.224 | ||
ENC004368 | ![]() |
0.547 | D0Y2NE | ![]() |
0.223 | ||
ENC004120 | ![]() |
0.546 | D01TNW | ![]() |
0.223 | ||
ENC005442 | ![]() |
0.504 | D06ZPS | ![]() |
0.221 | ||
ENC004369 | ![]() |
0.488 | D0Q9ON | ![]() |
0.217 |