![]() |
Name |
(6Z,14Z)-10-acetyl-1,22,29-trihydroxy-2,22-dimethyl-4,11,17,25-tetraoxahexacyclo[21.3.1.13,26.110,14.02,19.019,24]nonacosa-6,14-diene-5,16-dione
|
Molecular Formula | C29H38O10 | |
IUPAC Name* |
(6Z,14Z)-10-acetyl-1,22,29-trihydroxy-2,22-dimethyl-4,11,17,25-tetraoxahexacyclo[21.3.1.13,26.110,14.02,19.019,24]nonacosa-6,14-diene-5,16-dione
|
|
SMILES |
CC(=O)C12CC/C=C\C(=O)OC3CC4C5(C3(C6(CCC(C(C5)C6O4)(C)O)COC(=O)/C=C(\C1O)/CCO2)C)O
|
|
InChI |
InChI=1S/C29H38O10/c1-16(30)28-8-5-4-6-21(31)38-19-13-20-29(35)14-18-24(39-20)27(26(19,29)3,10-9-25(18,2)34)15-36-22(32)12-17(23(28)33)7-11-37-28/h4,6,12,18-20,23-24,33-35H,5,7-11,13-15H2,1-3H3/b6-4-,17-12-
|
|
InChIKey |
HGVKMRAJPCHSPC-OHZMSVKISA-N
|
|
Synonyms |
Myrothecine A; BS-1421
|
|
CAS | NA | |
PubChem CID | 156023522 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 546.6 | ALogp: | 0.6 |
HBD: | 3 | HBA: | 10 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 149.0 | Aromatic Rings: | 7 |
Heavy Atoms: | 39 | QED Weighted: | 0.416 |
Caco-2 Permeability: | -5.253 | MDCK Permeability: | 0.00002210 |
Pgp-inhibitor: | 0.834 | Pgp-substrate: | 0.066 |
Human Intestinal Absorption (HIA): | 0.169 | 20% Bioavailability (F20%): | 0.597 |
30% Bioavailability (F30%): | 0.867 |
Blood-Brain-Barrier Penetration (BBB): | 0.898 | Plasma Protein Binding (PPB): | 30.04% |
Volume Distribution (VD): | 0.403 | Fu: | 47.50% |
CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.792 |
CYP2C19-inhibitor: | 0.013 | CYP2C19-substrate: | 0.643 |
CYP2C9-inhibitor: | 0.004 | CYP2C9-substrate: | 0.049 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.069 |
CYP3A4-inhibitor: | 0.444 | CYP3A4-substrate: | 0.881 |
Clearance (CL): | 11.296 | Half-life (T1/2): | 0.298 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.154 |
Drug-inuced Liver Injury (DILI): | 0.443 | AMES Toxicity: | 0.041 |
Rat Oral Acute Toxicity: | 0.936 | Maximum Recommended Daily Dose: | 0.74 |
Skin Sensitization: | 0.007 | Carcinogencity: | 0.84 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.013 |
Respiratory Toxicity: | 0.026 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004392 | ![]() |
0.783 | D06XHC | ![]() |
0.292 | ||
ENC004393 | ![]() |
0.754 | D0M2QH | ![]() |
0.286 | ||
ENC004446 | ![]() |
0.646 | D0Q4SD | ![]() |
0.280 | ||
ENC002026 | ![]() |
0.584 | D0P0HT | ![]() |
0.277 | ||
ENC003310 | ![]() |
0.435 | D0I2SD | ![]() |
0.275 | ||
ENC003943 | ![]() |
0.394 | D0EP0C | ![]() |
0.268 | ||
ENC004774 | ![]() |
0.377 | D02JNM | ![]() |
0.267 | ||
ENC002696 | ![]() |
0.375 | D04GJN | ![]() |
0.266 | ||
ENC002240 | ![]() |
0.373 | D08PIQ | ![]() |
0.266 | ||
ENC004775 | ![]() |
0.372 | D09WYX | ![]() |
0.265 |