![]() |
Name |
Ethyl iso-allocholate
|
Molecular Formula | C27H48O5 | |
IUPAC Name* |
ethyl (4R)-4-[(3S,5R,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate;methane
|
|
SMILES |
C.CCOC(=O)CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@@H](C[C@@H]4[C@@]3(CC[C@@H](C4)O)C)O)O)C
|
|
InChI |
InChI=1S/C26H44O5.CH4/c1-5-31-23(30)9-6-15(2)18-7-8-19-24-20(14-22(29)26(18,19)4)25(3)11-10-17(27)12-16(25)13-21(24)28;/h15-22,24,27-29H,5-14H2,1-4H3;1H4/t15-,16-,17+,18-,19+,20+,21-,22+,24+,25+,26-;/m1./s1
|
|
InChIKey |
ZQJLVSITPFJEAT-PEDNHDMFSA-N
|
|
Synonyms |
Ethyl iso-allocholate; DTXSID001016575; 101230-69-7
|
|
CAS | 101230-69-7 | |
PubChem CID | 154734451 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 452.7 | ALogp: | 4.6 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 32 | QED Weighted: | 0.509 |
Caco-2 Permeability: | -4.736 | MDCK Permeability: | 0.00008310 |
Pgp-inhibitor: | 0.992 | Pgp-substrate: | 0.999 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.008 |
30% Bioavailability (F30%): | 0.412 |
Blood-Brain-Barrier Penetration (BBB): | 0.195 | Plasma Protein Binding (PPB): | 89.66% |
Volume Distribution (VD): | 0.545 | Fu: | 6.34% |
CYP1A2-inhibitor: | 0.113 | CYP1A2-substrate: | 0.208 |
CYP2C19-inhibitor: | 0.038 | CYP2C19-substrate: | 0.83 |
CYP2C9-inhibitor: | 0.103 | CYP2C9-substrate: | 0.072 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.115 |
CYP3A4-inhibitor: | 0.466 | CYP3A4-substrate: | 0.239 |
Clearance (CL): | 10.138 | Half-life (T1/2): | 0.861 |
hERG Blockers: | 0.741 | Human Hepatotoxicity (H-HT): | 0.388 |
Drug-inuced Liver Injury (DILI): | 0.04 | AMES Toxicity: | 0.004 |
Rat Oral Acute Toxicity: | 0.566 | Maximum Recommended Daily Dose: | 0.815 |
Skin Sensitization: | 0.928 | Carcinogencity: | 0.026 |
Eye Corrosion: | 0.062 | Eye Irritation: | 0.07 |
Respiratory Toxicity: | 0.95 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001007 | ![]() |
0.813 | D0OR2L | ![]() |
0.813 | ||
ENC000609 | ![]() |
0.630 | D03ZTE | ![]() |
0.630 | ||
ENC001009 | ![]() |
0.630 | D0G3SH | ![]() |
0.630 | ||
ENC005147 | ![]() |
0.395 | D0M4WA | ![]() |
0.527 | ||
ENC001603 | ![]() |
0.383 | D00VZZ | ![]() |
0.376 | ||
ENC005968 | ![]() |
0.383 | D0Y7LD | ![]() |
0.352 | ||
ENC005145 | ![]() |
0.361 | D09NNA | ![]() |
0.317 | ||
ENC000125 | ![]() |
0.355 | D0B4RU | ![]() |
0.304 | ||
ENC003557 | ![]() |
0.354 | D04DJN | ![]() |
0.295 | ||
ENC001008 | ![]() |
0.352 | D0T2PL | ![]() |
0.292 |