![]() |
Name |
Cylindrocarpone A
|
Molecular Formula | C14H12O6 | |
IUPAC Name* |
4,6,12-trihydroxy-8-methoxy-10-methyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-2-one
|
|
SMILES |
CC1=CC(=C2C3=C(C(OC2=O)O)C(=CC(=C13)OC)O)O
|
|
InChI |
InChI=1S/C14H12O6/c1-5-3-6(15)10-12-9(5)8(19-2)4-7(16)11(12)14(18)20-13(10)17/h3-4,14-16,18H,1-2H3
|
|
InChIKey |
RKOBCXJZRNWWNP-UHFFFAOYSA-N
|
|
Synonyms |
Cylindrocarpone A
|
|
CAS | NA | |
PubChem CID | 146684367 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 276.24 | ALogp: | 2.2 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 96.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 20 | QED Weighted: | 0.692 |
Caco-2 Permeability: | -5.144 | MDCK Permeability: | 0.00000445 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.55 |
Human Intestinal Absorption (HIA): | 0.314 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.349 |
Blood-Brain-Barrier Penetration (BBB): | 0.114 | Plasma Protein Binding (PPB): | 92.20% |
Volume Distribution (VD): | 0.855 | Fu: | 9.05% |
CYP1A2-inhibitor: | 0.743 | CYP1A2-substrate: | 0.892 |
CYP2C19-inhibitor: | 0.07 | CYP2C19-substrate: | 0.31 |
CYP2C9-inhibitor: | 0.235 | CYP2C9-substrate: | 0.863 |
CYP2D6-inhibitor: | 0.445 | CYP2D6-substrate: | 0.242 |
CYP3A4-inhibitor: | 0.155 | CYP3A4-substrate: | 0.124 |
Clearance (CL): | 6.466 | Half-life (T1/2): | 0.78 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.039 |
Drug-inuced Liver Injury (DILI): | 0.816 | AMES Toxicity: | 0.741 |
Rat Oral Acute Toxicity: | 0.046 | Maximum Recommended Daily Dose: | 0.914 |
Skin Sensitization: | 0.375 | Carcinogencity: | 0.109 |
Eye Corrosion: | 0.01 | Eye Irritation: | 0.96 |
Respiratory Toxicity: | 0.441 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004201 | ![]() |
0.692 | D07MGA | ![]() |
0.386 | ||
ENC004202 | ![]() |
0.597 | D06GCK | ![]() |
0.309 | ||
ENC005319 | ![]() |
0.449 | D0AZ8C | ![]() |
0.288 | ||
ENC002029 | ![]() |
0.449 | D04AIT | ![]() |
0.273 | ||
ENC005649 | ![]() |
0.442 | D0K8KX | ![]() |
0.267 | ||
ENC002516 | ![]() |
0.442 | D0L1JW | ![]() |
0.264 | ||
ENC005647 | ![]() |
0.442 | D04TDQ | ![]() |
0.252 | ||
ENC003504 | ![]() |
0.434 | D0I9HF | ![]() |
0.246 | ||
ENC004924 | ![]() |
0.409 | D0G4KG | ![]() |
0.244 | ||
ENC001631 | ![]() |
0.407 | D0C1SF | ![]() |
0.240 |