![]() |
Name |
(Z)-7-deoxy-7,8-didehydro-12-hydroxysydonic acid
|
Molecular Formula | C15H20O4 | |
IUPAC Name* |
3-hydroxy-4-[(Z)-7-hydroxy-6-methylhept-2-en-2-yl]benzoic acid
|
|
SMILES |
CC(CC/C=C(/C)\C1=C(C=C(C=C1)C(=O)O)O)CO
|
|
InChI |
InChI=1S/C15H20O4/c1-10(9-16)4-3-5-11(2)13-7-6-12(15(18)19)8-14(13)17/h5-8,10,16-17H,3-4,9H2,1-2H3,(H,18,19)/b11-5-
|
|
InChIKey |
OBFGWJDPNCOFSV-WZUFQYTHSA-N
|
|
Synonyms |
(Z)-7-deoxy-7,8-didehydro-12-hydroxysydonic acid
|
|
CAS | NA | |
PubChem CID | 146684348 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 264.32 | ALogp: | 3.1 |
HBD: | 3 | HBA: | 4 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 77.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 19 | QED Weighted: | 0.732 |
Caco-2 Permeability: | -4.761 | MDCK Permeability: | 0.00000561 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.364 |
Blood-Brain-Barrier Penetration (BBB): | 0.16 | Plasma Protein Binding (PPB): | 81.69% |
Volume Distribution (VD): | 0.317 | Fu: | 19.69% |
CYP1A2-inhibitor: | 0.359 | CYP1A2-substrate: | 0.259 |
CYP2C19-inhibitor: | 0.046 | CYP2C19-substrate: | 0.052 |
CYP2C9-inhibitor: | 0.149 | CYP2C9-substrate: | 0.055 |
CYP2D6-inhibitor: | 0.145 | CYP2D6-substrate: | 0.112 |
CYP3A4-inhibitor: | 0.063 | CYP3A4-substrate: | 0.098 |
Clearance (CL): | 5.769 | Half-life (T1/2): | 0.901 |
hERG Blockers: | 0.022 | Human Hepatotoxicity (H-HT): | 0.819 |
Drug-inuced Liver Injury (DILI): | 0.959 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.225 | Maximum Recommended Daily Dose: | 0.011 |
Skin Sensitization: | 0.129 | Carcinogencity: | 0.129 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.292 |
Respiratory Toxicity: | 0.077 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D01WJL | ![]() |
0.356 | ||||
![]() |
D0C4YC | ![]() |
0.311 | ||||
![]() |
D08HVR | ![]() |
0.294 | ||||
![]() |
D0BA6T | ![]() |
0.286 | ||||
![]() |
D0S2BT | ![]() |
0.286 | ||||
![]() |
D0V9EN | ![]() |
0.284 | ||||
![]() |
D07HBX | ![]() |
0.279 | ||||
![]() |
D0P7JZ | ![]() |
0.274 | ||||
![]() |
D03LGG | ![]() |
0.273 | ||||
![]() |
D0U5CE | ![]() |
0.273 |