![]() |
Name |
Xylarphthalide A
|
Molecular Formula | C11H10O6 | |
IUPAC Name* |
(3R)-7-hydroxy-3-[(1R)-1-hydroxyethyl]-1-oxo-3H-2-benzofuran-4-carboxylic acid
|
|
SMILES |
C[C@H]([C@H]1C2=C(C=CC(=C2C(=O)O1)O)C(=O)O)O
|
|
InChI |
InChI=1S/C11H10O6/c1-4(12)9-7-5(10(14)15)2-3-6(13)8(7)11(16)17-9/h2-4,9,12-13H,1H3,(H,14,15)/t4-,9+/m1/s1
|
|
InChIKey |
GYJYLNKUFQPNEA-MOFOKWOHSA-N
|
|
Synonyms |
Xylarphthalide A
|
|
CAS | NA | |
PubChem CID | 139591677 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 238.19 | ALogp: | 0.9 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 104.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 17 | QED Weighted: | 0.666 |
Caco-2 Permeability: | -5.695 | MDCK Permeability: | 0.00000461 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.049 |
Human Intestinal Absorption (HIA): | 0.026 | 20% Bioavailability (F20%): | 0.011 |
30% Bioavailability (F30%): | 0.877 |
Blood-Brain-Barrier Penetration (BBB): | 0.024 | Plasma Protein Binding (PPB): | 87.29% |
Volume Distribution (VD): | 0.938 | Fu: | 16.54% |
CYP1A2-inhibitor: | 0.065 | CYP1A2-substrate: | 0.065 |
CYP2C19-inhibitor: | 0.027 | CYP2C19-substrate: | 0.047 |
CYP2C9-inhibitor: | 0.308 | CYP2C9-substrate: | 0.135 |
CYP2D6-inhibitor: | 0.02 | CYP2D6-substrate: | 0.12 |
CYP3A4-inhibitor: | 0.018 | CYP3A4-substrate: | 0.019 |
Clearance (CL): | 1.313 | Half-life (T1/2): | 0.909 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.23 |
Drug-inuced Liver Injury (DILI): | 0.985 | AMES Toxicity: | 0.018 |
Rat Oral Acute Toxicity: | 0.11 | Maximum Recommended Daily Dose: | 0.025 |
Skin Sensitization: | 0.618 | Carcinogencity: | 0.202 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.521 |
Respiratory Toxicity: | 0.742 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004808 | ![]() |
0.571 | D01WJL | ![]() |
0.345 | ||
ENC005940 | ![]() |
0.571 | D0C4YC | ![]() |
0.345 | ||
ENC005533 | ![]() |
0.537 | D07HBX | ![]() |
0.309 | ||
ENC003237 | ![]() |
0.500 | D0I3RO | ![]() |
0.292 | ||
ENC004561 | ![]() |
0.491 | D07AHW | ![]() |
0.288 | ||
ENC004562 | ![]() |
0.491 | D08LFZ | ![]() |
0.288 | ||
ENC005535 | ![]() |
0.466 | D07JGT | ![]() |
0.282 | ||
ENC002496 | ![]() |
0.450 | D08HVR | ![]() |
0.281 | ||
ENC005906 | ![]() |
0.450 | D0G5UB | ![]() |
0.280 | ||
ENC002497 | ![]() |
0.450 | D00KRE | ![]() |
0.280 |